CAS 84-39-9

(-)-Stylopine

Description:

(-)-Stylopine is a naturally occurring alkaloid primarily derived from various plant species, particularly those in the Papaveraceae family. It is characterized by its complex tetracyclic structure, which includes a benzene ring fused to a piperidine and a pyridine ring. This compound exhibits a range of biological activities, including potential analgesic and anti-inflammatory properties, making it of interest in pharmacological research. (-)-Stylopine is typically found in the form of a yellowish crystalline solid and is soluble in organic solvents such as ethanol and chloroform, but less soluble in water. Its stereochemistry is significant, as the (-) designation indicates its specific optical activity, which can influence its interaction with biological systems. The compound's molecular formula reflects its composition of carbon, hydrogen, and nitrogen atoms, contributing to its diverse chemical behavior. Overall, (-)-Stylopine serves as an important subject of study in both natural product chemistry and medicinal chemistry due to its potential therapeutic applications.

Formula: C₁₉H₁₇NO₄

InChI: InChI=1S/C19H17NO4/c1-2-16-19(24-10-21-16)14-8-20-4-3-12-6-17-18(23-9-22-17)7-13(12)15(20)5-11(1)14/h1-2,6-7,15H,3-5,8-10H2/t15-/m0/s1

InChI key: InChIKey=UXYJCYXWJGAKQY-HNNXBMFYSA-N

SMILES: [C@@]12(C=3C(=CC4=C(C3)OCO4)CCN1CC=5C(C2)=CC=C6C5OCO6)[H]

Synonyms:

• 13aα-Berbine, 2,3:9,10-bis(methylenedioxy)-
• (12bS)-6,7,12b,13-Tetrahydro-4H-bis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizine
• 4H-Bis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizine, 6,7,12b,13-tetrahydro-, (S)-
• 2,3:9,10-Bis(methylenedioxy)-(-)-tetrahydroberberine
• 4H-Bis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizine, 6,7,12b,13-tetrahydro-, (12bS)-

Stylopine

CAS: 84-39-9

Formula: C₁₉H₁₇NO₄

Purity: 95%~99%

Color and Shape: Cryst.

Molecular weight: 323.348

Ref: BP-SBP04382

(-)-Stylopine

CAS: 84-39-9

(-)-Stylopine is an isoquinoline alkaloid, which is a naturally occurring compound found in several plant species, particularly within the Papaveraceae family. This compound is synthesized in plants through a complex series of enzymatic reactions that involve the transformation of precursor molecules into intricate alkaloid structures, often serving as a chemical defense against herbivores and pathogens.

Formula: C₁₉H₁₇NO₄

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 323.34 g/mol

Ref: 3D-FS137984