CAS 85118-33-8
:Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-, hydrochloride (1:1)
Description:
Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which combines an isoxazole ring with a pyridine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its hydrochloride salt form. The presence of the tetrahydro group indicates that it has undergone partial saturation, which can influence its reactivity and biological activity. Isoxazoles are known for their diverse pharmacological properties, including potential applications in medicinal chemistry. The hydrochloride salt form enhances its stability and solubility, making it more suitable for various applications, including drug formulation. The compound's CAS number, 85118-33-8, allows for precise identification in chemical databases. As with many heterocyclic compounds, it may exhibit interesting electronic properties and reactivity patterns, making it a subject of interest in both synthetic and medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C6H8N2O2·ClH
InChI:InChI=1S/C6H8N2O2.ClH/c9-6-4-1-2-7-3-5(4)10-8-6;/h7H,1-3H2,(H,8,9);1H
InChI key:InChIKey=ZDZDSZQYRBZPNN-UHFFFAOYSA-N
SMILES:O=C1C2=C(CNCC2)ON1.Cl
Synonyms:- 4,5,6,7-Tetrahydroisoxazolo(5,4-c)pyridin-3(2H)-one monohydrochloride
- Gaboxadol hydrochloride
- THIP hydrochloride
- 4,5,6,7-Tetrahydroisoxazolo[5,4-c]pyridin-3-ol hydrochloride
- Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-, monohydrochloride
- Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Gaboxadol Hydrochloride
CAS:Formula:C6H8N2O2·HClPurity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:176.60Gaboxadol Hydrochloride
CAS:Formula:C6H9ClN2O2Purity:98%Color and Shape:SolidMolecular weight:176.6009Gaboxadol hydrochloride
CAS:Formula:C6H8N2O2·HClPurity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:176.60Gaboxadol hydrochloride
CAS:Gaboxadol (hydrochloride) is a GABAA receptor agonist.Formula:C6H9ClN2O2Purity:99.39%Molecular weight:176.6014,5,6,7-TETRAHYDROISOXAZOLO[5,4-C]PYRIDIN-3-OL HCL, GABOXADOL-HCL
CAS:Formula:C6H9ClN2O2Purity:98%Molecular weight:176.6Gaboxadol Hydrochloride
CAS:Controlled Product<p>Applications Gaboxadol is a sleep aid drug used for the treatment of chronic pain and insomnia. Gaboxadol is also known to exhibit antidepressant like properties through its agonistic activities towards GABA sites.<br>References Vashchinkina, E., et al.: J. Neurosci., 32, 5310 (2012); Christensen, T., et al.: Eur. Neuropsychopharmacol., 22, 751 (2012);<br></p>Formula:C6H8N2O2·(HCl)Color and Shape:NeatMolecular weight:140.14 + (36.46)








