CymitQuimica logo

CAS 865811-59-2

:

[[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-methyl-phenyl-silyl]oxy-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane

Description:
The chemical substance with the name "[[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-methyl-phenyl-silyl]oxy-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane" and CAS number 865811-59-2 is a silane compound characterized by its complex structure, which includes multiple functional groups such as siloxane, ether, and epoxide functionalities. This compound typically exhibits properties associated with silanes, including reactivity with moisture, potential for cross-linking, and the ability to bond with various substrates, making it useful in applications such as surface modification, adhesion promotion, and as a coupling agent in polymer formulations. The presence of the epoxide groups suggests potential for further chemical reactivity, allowing for the formation of additional bonds or networks upon curing or in the presence of nucleophiles. Its unique structure may also impart specific physical properties, such as enhanced thermal stability and mechanical strength, depending on the overall molecular arrangement and the presence of other functional groups. Overall, this compound is likely to be of interest in materials science and chemical engineering applications.
Formula:C23H42O6Si3
InChI:InChI=1/C23H42O6Si3/c1-30(2,15-9-13-24-17-21-19-26-21)28-32(5,23-11-7-6-8-12-23)29-31(3,4)16-10-14-25-18-22-20-27-22/h6-8,11-12,21-22H,9-10,13-20H2,1-5H3
SMILES:C[Si](C)(CCCOCC1CO1)O[Si](C)(c1ccccc1)O[Si](C)(C)CCCOCC1CO1
Synonyms:
  • bis[[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy]-methyl-phenylsilane
  • Trisiloxane, 1,1,3,5,5-pentamethyl-1,5-bis[3-(oxiranylmethoxy)propyl]-3-phenyl-
  • 1,5-BIS(GLYCIDOXYPROPYL)-3-PHENYL-1,1,3,5,5-PENTAMETHYLTRISILOXANE
  • [[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-methyl-ph...
  • Epoxy-terminated phenyltris loxane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.