CAS 87500-51-4
:Benzene, (ethenylsulfinyl)-, homopolymer
Description:
Benzene, (ethenylsulfinyl)-, homopolymer, identified by CAS number 87500-51-4, is a synthetic polymer characterized by its structure, which includes a benzene ring and sulfinyl groups. This polymer is typically produced through the polymerization of vinyl sulfone derivatives, leading to a material that exhibits unique properties. It is known for its chemical stability, resistance to heat, and potential for various applications in industries such as adhesives, coatings, and sealants. The presence of sulfinyl groups can enhance the polymer's reactivity, allowing for further functionalization or cross-linking, which can improve its mechanical properties and durability. Additionally, the polymer may exhibit interesting electrical and thermal conductivity characteristics, making it suitable for specialized applications in electronics or materials science. Safety and handling considerations are important, as with many synthetic polymers, and proper precautions should be taken to minimize exposure during processing or use.
Formula:(C8H8OS)x
InChI:InChI=1S/C8H8OS/c1-2-10(9)8-6-4-3-5-7-8/h2-7H,1H2
InChI key:InChIKey=MZMJHXFYLRTLQX-UHFFFAOYSA-N
SMILES:S(C=C)(=O)C1=CC=CC=C1
Synonyms:- Benzene, (ethenylsulfinyl)-, homopolymer
- Phenyl vinyl sulfoxide homopolymer
- Poly(vinyl phenyl sulfoxide)
- Phenyl vinyl sulfoxide polymer
- Poly(phenyl vinyl sulfoxide)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
