CAS 879615-84-6
:4-(2,3-dihydro-1H-indol-1-yl)-1,3,5-triazin-2-amine
Description:
4-(2,3-dihydro-1H-indol-1-yl)-1,3,5-triazin-2-amine, with the CAS number 879615-84-6, is a chemical compound characterized by its unique structure that includes a triazine ring and an indole moiety. This compound typically exhibits properties associated with both heterocyclic compounds and amines, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of amino groups. The indole structure contributes to its aromatic characteristics, which may influence its reactivity and interactions with biological systems. Compounds like this are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of multiple functional groups can also suggest diverse reactivity, making it a candidate for various chemical transformations. Overall, the specific characteristics, including stability, reactivity, and biological activity, would depend on the compound's environment and the presence of other functional groups or substituents.
Formula:C11H11N5
InChI:InChI=1/C11H11N5/c12-10-13-7-14-11(15-10)16-6-5-8-3-1-2-4-9(8)16/h1-4,7H,5-6H2,(H2,12,13,14,15)
SMILES:c1ccc2c(c1)CCN2c1ncnc(=N)[nH]1
Synonyms:- 1,3,5-triazin-2-amine, 4-(2,3-dihydro-1H-indol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
