CAS 89364-31-8
:tetrahydro-3-furoic acid
Description:
Tetrahydro-3-furoic acid is a cyclic carboxylic acid characterized by its five-membered furan ring structure that has undergone hydrogenation, resulting in a saturated compound. It features a carboxylic acid functional group, which imparts acidic properties to the molecule. This compound is typically a colorless to pale yellow liquid and is soluble in water and organic solvents, making it versatile for various applications. Tetrahydro-3-furoic acid is known for its potential use in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Its structure allows for various chemical modifications, enhancing its utility in synthetic chemistry. Additionally, it may exhibit mild toxicity, necessitating appropriate handling and safety precautions during use. Overall, tetrahydro-3-furoic acid is an important compound in organic chemistry with applications in both industrial and research settings.
Formula:C5H8O3
InChI:InChI=1/C5H8O3/c6-5(7)4-1-2-8-3-4/h4H,1-3H2,(H,6,7)
SMILES:C1COCC1C(=O)O
Synonyms:- Tetrahydrofuran-3-Carboxylic Acid
- 3-Furancarboxylic acid, tetrahydro-
- Oxolane-3-Carboxylic Acid
- Tetrahydro-furan-3-carboxylic acid
- Tetrahydro-3-Furancarboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Tetrahydrofuran-3-carboxylic acid
CAS:Tetrahydrofuran-3-carboxylic acidFormula:C5H8O3Purity:≥95%Color and Shape: clear liquidMolecular weight:116.12g/molTetrahydrofuran-3-carboxylic Acid
CAS:Formula:C5H8O3Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:116.12Tetrahydro-furan-3-carboxylic acid
CAS:Formula:C5H8O3Purity:97%Color and Shape:LiquidMolecular weight:116.116Tetrahydro-3-furoic Acid
CAS:Controlled ProductApplications Used in the synthesis of anti-tumor compounds comprising of hydroxyisovalerylshikonin analogs. Furthermore, the compound is a reagent in the synthesis of class II c-Met inhibitors, in the treatment of c-Met dependant tumors.
References Rao, Z. et al.: Eur. J. Med. Chem., 46, 3934 (2011); Liu, L. et al.: J. Med. Chem., 55, 1868 (2012);Formula:C5H8O3Color and Shape:NeatMolecular weight:116.12Tetrahydro-3-furoic acid
CAS:Tetrahydro-3-furoic acid is an organic acid that can be found in the form of its tautomers, alpha-methylene-gamma-butyrolactone and 3-hydroxy-2,4-pentadienoic acid. It is a proapoptotic compound that induces cell death in cancer cells by inhibiting protein synthesis. Tetrahydro-3-furoic acid has been shown to have low expression levels in most tissues, with high levels found in the liver. The mechanism behind this inhibition is not yet known but may be due to the formation of a Schiff base between the amine and the carbonyl group of tetrahydro-3-furoic acid. This reaction mechanism has been proposed as a possible explanation for why tetrahydro-3-furoic acid is more toxic than other furoates such as ethyl-, propyl-, butyl-, and amyl-. TetFormula:C5H8O3Purity:Min. 95%Molecular weight:116.12 g/mol





