CAS 904813-28-1

1-[(4-methylphenyl)sulfonyl]imidazo[1,5-a]pyridine

Description:

1-[(4-methylphenyl)sulfonyl]imidazo[1,5-a]pyridine is a chemical compound characterized by its unique structural features, which include an imidazo[1,5-a]pyridine core fused with a sulfonyl group attached to a 4-methylphenyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the sulfonyl group can enhance its reactivity and influence its interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the methyl group on the phenyl ring may affect its lipophilicity and overall pharmacokinetic properties. The compound's molecular structure suggests potential applications in drug development, particularly in the search for new therapeutic agents. As with many organic compounds, its stability, reactivity, and solubility can vary based on environmental conditions and the presence of other chemical species. Overall, 1-[(4-methylphenyl)sulfonyl]imidazo[1,5-a]pyridine represents a class of compounds that may hold promise in various chemical and pharmaceutical applications.

Formula: C₁₄H₁₂N₂O₂S

InChI: InChI=1/C14H12N2O2S/c1-11-5-7-12(8-6-11)19(17,18)14-13-4-2-3-9-16(13)10-15-14/h2-10H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)c1c2ccccn2cn1

Synonyms:

• 1-[(4-Methylphenyl)sulfonyl]imidazo[1,5-a]pyridin
• Imidazo[1,5-A]Pyridine, 1-[(4-Methylphenyl)Sulfonyl]-

1-(4-methylbenzenesulfonyl)imidazo[1,5-a]pyridine

CAS: 904813-28-1

Purity: 95.0%

Molecular weight: 272.32000732421875

Ref: 10-F526117