CAS 92841-22-0
:1-(6-chloro-9H-carbazol-2-yl)ethanone
Description:
1-(6-Chloro-9H-carbazol-2-yl)ethanone is an organic compound characterized by its structure, which includes a carbazole moiety substituted with a chloro group and an ethanone functional group. The presence of the chloro substituent enhances its reactivity and may influence its biological activity. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions. It is likely to be a solid at room temperature, given the structural characteristics of similar compounds. The ethanone group introduces a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions. Additionally, the compound may exhibit fluorescence due to the presence of the conjugated aromatic system, making it of interest in materials science and organic electronics. Its specific applications could range from pharmaceuticals to dyes, depending on its biological activity and solubility characteristics. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks.
Formula:C14H10ClNO
InChI:InChI=1/C14H10ClNO/c1-8(17)9-2-4-11-12-7-10(15)3-5-13(12)16-14(11)6-9/h2-7,16H,1H3
SMILES:CC(=O)c1ccc2c3cc(ccc3[nH]c2c1)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(6-Chloro-9H-carbazol-2-yl)ethanone
CAS:1-(6-Chloro-9H-carbazol-2-yl)ethanone is a chemical substance that belongs to the class of synthetic drugs. It is used as a pharmaceutical intermediate in the production of other chemical substances, including antibiotics and antihypertensives. 1-(6-Chloro-9H-carbazol-2-yl)ethanone has been shown to be metabolized by cytochrome P450 enzymes and by glucuronidases or esterases. This product can also be used as an impurity standard for HPLC analyses of fluoroquinolones.
Formula:C14H10ClNOPurity:Min. 95%Molecular weight:243.69 g/mol


