CymitQuimica logo

CAS 939759-19-0

:

9-Chloro-2,3,4,5-tetrahydro-1H-1-benzazepine

Description:
9-Chloro-2,3,4,5-tetrahydro-1H-1-benzazepine is a chemical compound characterized by its unique bicyclic structure, which consists of a benzene ring fused to a seven-membered nitrogen-containing ring. This compound features a chlorine atom at the 9-position, contributing to its reactivity and potential biological activity. The tetrahydro configuration indicates that the compound has four hydrogen atoms added to the nitrogen-containing ring, resulting in a saturated structure. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, which may include effects on neurotransmitter systems. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. The CAS number 939759-19-0 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, 9-Chloro-2,3,4,5-tetrahydro-1H-1-benzazepine exemplifies the complexity and diversity of nitrogen-containing heterocycles in organic chemistry.
Formula:C10H12ClN
InChI:InChI=1S/C10H12ClN/c11-9-6-3-5-8-4-1-2-7-12-10(8)9/h3,5-6,12H,1-2,4,7H2
InChI key:InChIKey=WOAGHSOIENSQDJ-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC=C1)CCCCN2
Synonyms:
  • 9-Chloro-2,3,4,5-tetrahydro-1H-1-benzazepine
  • 1H-1-Benzazepine, 9-chloro-2,3,4,5-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.