CAS 951886-99-0

Methanone, (3,4-dichlorophenyl)(3-fluoro-5-methylphenyl)-

Description:

Methanone, (3,4-dichlorophenyl)(3-fluoro-5-methylphenyl)-, also known by its CAS number 951886-99-0, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a methanone moiety bonded to two distinct phenyl groups: one substituted with chlorine atoms at the 3 and 4 positions, and the other with a fluorine atom at the 3 position and a methyl group at the 5 position. The presence of these halogen and alkyl substituents can significantly influence the compound's chemical reactivity, stability, and solubility. Typically, such compounds may exhibit interesting biological activities, making them of interest in pharmaceutical research. Additionally, the specific arrangement of substituents can affect the compound's electronic properties, potentially leading to varied interactions in chemical reactions. As with many organic compounds, safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.

Formula: C₁₄H₉Cl₂FO

InChI: InChI=1S/C14H9Cl2FO/c1-8-4-10(6-11(17)5-8)14(18)9-2-3-12(15)13(16)7-9/h2-7H,1H3

InChI key: InChIKey=DIPHKCVURIJALQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=CC(F)=C1)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• Methanone, (3,4-dichlorophenyl)(3-fluoro-5-methylphenyl)-
• (3,4-Dichlorophenyl)-(3-fluoro-5-methylphenyl)methanone
• 3,4-Dichloro-3′-fluoro-5′-methylbenzophenone

3,4-Dichloro-3′-fluoro-5′-methylbenzophenone

CAS: 951886-99-0

Formula: C₁₄H₉Cl₂FO

Purity: 97.0%

Molecular weight: 283.12

Ref: 10-F202150