CymitQuimica logo

CAS 95233-36-6

:

1-[4-(4-chlorophenyl)cyclohexyl]ethanone

Description:
1-[4-(4-chlorophenyl)cyclohexyl]ethanone, with the CAS number 95233-36-6, is an organic compound characterized by its ketone functional group and a cyclohexyl ring substituted with a para-chlorophenyl group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry and as a synthetic intermediate. The presence of the chlorophenyl group can influence its reactivity and biological activity, often enhancing lipophilicity and modulating interactions with biological targets. The compound's molecular structure suggests it may exhibit specific stereochemical properties, which can affect its pharmacological profile. Additionally, its synthesis may involve standard organic reactions such as Friedel-Crafts acylation or other coupling methods. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or environmental impact. Overall, 1-[4-(4-chlorophenyl)cyclohexyl]ethanone represents a class of compounds of interest in both research and industrial applications.
Formula:C14H17ClO
InChI:InChI=1/C14H17ClO/c1-10(16)11-2-4-12(5-3-11)13-6-8-14(15)9-7-13/h6-9,11-12H,2-5H2,1H3
SMILES:CC(=O)C1CCC(CC1)c1ccc(cc1)Cl
Synonyms:
  • 4'-Acetylcyclohexyl-4-chlorobenzene
  • Ethanone, 1-[4-(4-Chlorophenyl)Cyclohexyl]-
  • 1-[4-(4-Chlorophenyl)cyclohexyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.