
CAS 95245-30-0
:D-Mannose, 4,4′-O-(2-amino-1,3-propanediyl)bis-, hydrochloride
Description:
D-Mannose, 4,4′-O-(2-amino-1,3-propanediyl)bis-, hydrochloride is a synthetic derivative of mannose, a simple sugar that plays a crucial role in various biological processes. This compound features a bis-amino linkage, which enhances its solubility and potential biological activity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. The presence of amino groups suggests potential interactions with biological macromolecules, which may influence its pharmacokinetics and pharmacodynamics. D-Mannose itself is known for its role in urinary tract health, as it can inhibit the adhesion of certain bacteria to the urinary tract lining. The hydrochloride form may be utilized in research and therapeutic contexts, particularly in studies related to glycosylation and carbohydrate metabolism. Overall, this compound exemplifies the intersection of carbohydrate chemistry and medicinal applications, with characteristics that may be leveraged for health-related benefits.
Formula:C15H29NO12·ClH
InChI:InChI=1S/C15H29NO12.ClH/c16-7(5-27-14(10(23)3-19)12(25)8(21)1-17)6-28-15(11(24)4-20)13(26)9(22)2-18;/h1-2,7-15,19-26H,3-6,16H2;1H/t8-,9-,10-,11-,12-,13-,14-,15-;/m1./s1
InChI key:InChIKey=WLDIILQYCWXFHW-KRJKXYNPSA-N
SMILES:[C@@H]([C@@H]([C@@H](C=O)O)O)(OCC(CO[C@@H]([C@@H]([C@@H](C=O)O)O)[C@@H](CO)O)N)[C@@H](CO)O.Cl
Synonyms:- D-Mannose, 4,4′-O-(2-amino-1,3-propanediyl)bis-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4,4'-O-(2-Amino-1,3-propanediyl)bis-D-mannose Hydrochloride
CAS:Controlled ProductStability Very Hygroscopic
Applications Used in the synthesis of novel bis(D-mannose) compounds.
References Holman, G.D., et al.: Carbohydrate Res., 135, 337 (1985),Formula:C15H30ClNO12Color and Shape:NeatMolecular weight:451.85
