CAS 97605-25-9

Isoscoparin-2′′O-glucoside

Description:

Isoscoparin-2′′O-glucoside is a flavonoid glycoside, a type of compound commonly found in various plants, particularly in the family of herbs and vegetables. This compound is characterized by its structure, which includes a flavonoid aglycone linked to a glucose molecule through a glycosidic bond. It exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential antimicrobial properties, making it of interest in pharmacological research. Isoscoparin-2′′O-glucoside is often studied for its role in traditional medicine and its potential health benefits. Its solubility and stability can vary depending on environmental conditions, such as pH and temperature. Additionally, like many flavonoids, it may contribute to the color and flavor of the plants in which it is found. The compound's specific interactions with biological systems and its mechanisms of action are areas of ongoing research, highlighting its significance in both natural product chemistry and therapeutic applications.

Formula: C₂₈H₃₂O₁₆

InChI: InChI=1S/C28H32O16/c1-40-14-4-9(2-3-10(14)31)13-5-11(32)18-15(41-13)6-12(33)19(22(18)36)26-27(24(38)21(35)16(7-29)42-26)44-28-25(39)23(37)20(34)17(8-30)43-28/h2-6,16-17,20-21,23-31,33-39H,7-8H2,1H3/t16-,17-,20-,21-,23+,24+,25-,26+,27-,28+/m1/s1

InChI key: InChIKey=AQQFWSYLUDMDBP-ODEMIOGVSA-N

SMILES: OC=1C(=C(O)C=C2C1C(=O)C=C(O2)C3=CC(OC)=C(O)C=C3)[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4

Synonyms:

• Isoscoparin-2′′O-glucoside
• 6-(2-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 6-(2-O-β-D-glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-

Isoscoparin-2′′O-glucoside

CAS: 97605-25-9

Isoscoparin-2''-Beta-D-glucopyranoside shows prominent free radical scavenging activity in DPPH assay.

Formula: C₂₈H₃₂O₁₆

Purity: 99.84%

Color and Shape: Solid

Molecular weight: 624.54

Ref: TM-TN1802

Isoscoparin-2''-O-glucoside

CAS: 97605-25-9

Formula: C₂₈H₃₂O₁₆

Purity: 95%~99%

Molecular weight: 624.548

Ref: BP-BP4622

Isoscoparin-2-²-D-glucopyranoside

CAS: 97605-25-9

Isoscoparin-2-β-D-glucopyranoside is a flavonoid glycoside, which is naturally sourced from certain plant species. This compound is a derivative of isoscoparin, a well-known flavonoid, characterized by a glucose moiety attached to its structure. The primary mode of action involves its antioxidant properties, attributed to its ability to scavenge free radicals and inhibit lipid peroxidation. Additionally, it may interfere with various cellular pathways, offering potential anti-inflammatory and anti-cancer effects.

Formula: C₂₈H₃₂O₁₆

Purity: Min. 95%

Molecular weight: 624.54 g/mol

Ref: 3D-XDA60525