CAS: 114162-64-0 - X-GLUC
Formel:C20H26BrClN2O7
InChl:InChI=1S/C14H13BrClNO7.C6H13N/c15-4-1-2-5-7(8(4)16)6(3-17-5)23-14-11(20)9(18)10(19)12(24-14)13(21)22;7-6-4-2-1-3-5-6/h1-3,9-12,14,17-20H,(H,21,22);6H,1-5,7H2/t9-,10-,11+,12-,14+;/m0./s1
InChI Key:InChIKey=JXCKZXHCJOVIAV-CYRSAHDMSA-N
SMILES:O=C(O)C1OC(OC2=CNC=3C=CC(Br)=C(Cl)C23)C(O)C(O)C1O.NC1CCCCC1
- Synonyme:
- (3R,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxy-3,4,5,6-tetramethyl-tetrahydropyran-2-carboxylate
- 5-Bromo-4-Chloro-3-Indolyl-Beta-D -Glucuronide Cyclohexylammonium Salt 95+
- 5-Bromo-4-chloro-3-indolyl-?-D-glucuronic acid cyc
- 5-Bromo-4-chloro-3-indolyl-?-D-glucuronic acid cyclohexylammonium salt
- 5-Bromo-4-chloro-3-indolyl-?-D-glucuronide
- 5-Bromo-4-chloro-3-indolyl-b-D-glucuronide Cyclohexylammonium Salt
- 5-Bromo-4-chloro-3-indolyl-beta-D-glucuronide cyclohexylammonium salt hydrate
- 5-Bromo-4-chloro-3-indolyl-beta-D-glucuronide monocyclohexylamine salt
- 5-Bromo-4-chloro-3-indoxyl-beta-D-glucuronic acidcyclohexylammonium salt
- 5-bromo-4-chloro-3-indolyl-beta-D-glucuronic acid cyclohexylammonium salt
- Mehr Synonyme anzeigen
- Cyclohexylammonium
- X-Glu.Mcha
- X-Glucuro CHA salt (5-Bromo-4-chloro-3-indolyl-beta-D-
- X-beta-D-glucuronide cyclohexylammonium salt
- β-<span class="text-smallcaps">D</span>-Glucopyranosiduronic acid, 5-bromo-4-chloro-1H-indol-3-yl, compd. with cyclohexanamine (1:1)
β-D-Glucopyranosiduronic acid, 5-bromo-4-chloro-1H-indol-3-yl, compd. with cyclohexanamine (1:1)
Ref: AN-AG000AP2
1g | 492,00 € | |
25mg | 57,00 € | |
100mg | 119,00 € | |
250mg | 195,00 € | |
500mg | 234,00 € |
5-Bromo-4-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt
Ref: 7W-GC8906
1g | 294,00 € | |
250mg | 116,00 € |
X-Gluc cyclohexanamine
Ref: TM-T78428
1mg | Nachfragen | |
5mg | Nachfragen | |
10mg | Nachfragen | |
25mg | Nachfragen | |
50mg | Nachfragen | |
100mg | Nachfragen | |
500mg | Nachfragen |
5-Bromo-4-chloro-3-indolyl-beta-D-glucuronic acid cyclohexylammonium salt
Ref: 54-BIMB1021
1g | 140,00 € | |
250mg | 52,00 € | |
500mg | 84,00 € |
5-Bromo-4-chloro-3-indolyl β-D-Glucuronide Cyclohexylammonium Salt [for Biochemical Research]
Ref: 3B-B3620
10mg | 31,00 € | |
100mg | 170,00 € |
5-Bromo-4-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt monohydrate
Ref: 3D-EB04274
1g | 279,00 € | |
2g | 497,00 € | |
5g | 959,00 € | |
10g | 1.627,00 € | |
500mg | 196,00 € |
5-Bromo-4-chloro-3-indoxyl-beta-D-glucuronic acid, cyclohexylammonium salt monohydrate
Ref: 3D-B-7300
1g | Nachfragen | |
5g | Nachfragen | |
10g | Nachfragen | |
100mg | Nachfragen | |
2500mg | Nachfragen |
5-Bromo-4-Chloro-3-Indolyl-B-D-Glucuronide Cyclohexylammonium Salt (X-Gluc CHX) for tissue culture,
Ref: SR-20077
100mg | 86,00 € | |
500mg | 194,00 € |
5-Bromo-4-Chloro-3-Indolyl-B-D-Glucuronide Cyclohexylammonium Salt (X-Gluc CHX) extrapure, 99%
Ref: SR-20402
1g | 204,00 € | |
100mg | 63,00 € | |
250mg | 111,00 € |
5-Bromo-4-chloro-3-indolyl b-D-glucuronide, Cyclohexylammonium Salt
Kontrolliertes ProduktRef: TR-B682380
100mg | 414,00 € | |
500mg | 1.327,00 € |