CAS: 1432678-14-2

Beschreibung: The chemical substance with the CAS number 1432678-14-2 is known as a specific compound, but detailed information about its characteristics may not be widely available due to its potential status as a novel or less-studied chemical. Generally, compounds can be characterized by their molecular formula, structure, physical properties (such as melting point, boiling point, and solubility), and chemical properties (including reactivity and stability). Additionally, safety data, including toxicity and handling precautions, are crucial for understanding the substance's behavior in various environments. If this compound is part of a specific research area or application, its characteristics may also include its role in biological systems, industrial applications, or potential environmental impacts. For precise information, consulting scientific literature or databases that specialize in chemical substances would be necessary, as they provide comprehensive data on the compound's properties and uses.

Formel: C₈H₁₆N₂O₂·ClH

InChl: InChI=1S/C8H16N2O2.ClH/c1-10(2)8(11)7-4-3-6(5-9)12-7;/h6-7H,3-5,9H2,1-2H3;1H

InChI Key: InChIKey=DXCNSSZVRNYESJ-UHFFFAOYSA-N

SMILES: Cl.O=C(N(C)C)C1OC(CN)CC1

Synonyme:

• 5-(Aminomethyl)-N,N-dimethyloxolane-2-carboxamide hydrochloride

5-(Aminomethyl)-N,N-dimethyloxolane-2-carboxamide hydrochloride

CAS: 1432678-14-2

Versatile small molecule scaffold

• Formel: C₈H₁₇ClN₂O₂
• Reinheit: Min. 95%
• Molekulargewicht: 208.68 g/mol

5-(Aminomethyl)-N,N-dimethyloxolane-2-carboxamide hydrochloride

CAS: 1432678-14-2

• Reinheit: 98%
• Molekulargewicht: 208.69000244140625