
CAS: 1523618-10-1
Beschreibung:The chemical substance with the CAS number 1523618-10-1 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds identified by CAS numbers can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical behavior (including reactivity and stability). Additionally, the compound may have applications in various fields, such as pharmaceuticals, materials science, or agriculture, depending on its functional groups and overall structure. To obtain precise characteristics, including safety data, toxicity, and specific applications, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive information on the substance in question.
Formel:C9H12N2OS
InChl:InChI=1S/C9H12N2OS/c10-7-1-3-8(4-2-7)13(11,12)9-5-6-9/h1-4,9,11H,5-6,10H2
InChI Key:InChIKey=NLKQFDBGCBBXDX-UHFFFAOYSA-N
SMILES:O=S(=N)(C1=CC=C(N)C=C1)C2CC2
Marke | Produktdaten | Reinheit | Preisklasse | Voraussichtliche Lieferung |
---|---|---|---|---|
![]() | 4-(Cyclopropylsulfonimidoyl)aniline REF: IN-DA0209DJCAS: 1523618-10-1 | 98% | Nachfragen | Do 27 Mär 25 |
![]() | 4-(Cyclopropylsulfonimidoyl)aniline REF: 54-OR88176CAS: 1523618-10-1 | 95% | 396,00 €~1.456,00 € | Fr 28 Mär 25 |
![]() | 4-(Cyclopropylsulfonimidoyl)aniline REF: 10-F625339CAS: 1523618-10-1 | 98% | 264,00 €~3.568,00 € | Di 01 Apr 25 |

4-(Cyclopropylsulfonimidoyl)aniline
Ref: IN-DA0209DJ
1g | Nachfragen | ||
5g | Nachfragen | ||
100mg | 187,00 € | ||
250mg | 309,00 € |

Ref: 54-OR88176
1g | 1.456,00 € | ||
100mg | 396,00 € | ||
250mg | 632,00 € | ||
500mg | 1.036,00 € |

Ref: 10-F625339
1g | 968,00 € | ||
5g | 3.568,00 € | ||
100mg | 264,00 € | ||
250mg | 407,00 € | ||
500mg | 528,00 € |