Das Produkt wurde korrekt in den Warenkorb gelegt.

Kein Bild

CAS: 1523618-10-1

Beschreibung:The chemical substance with the CAS number 1523618-10-1 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds identified by CAS numbers can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical behavior (including reactivity and stability). Additionally, the compound may have applications in various fields, such as pharmaceuticals, materials science, or agriculture, depending on its functional groups and overall structure. To obtain precise characteristics, including safety data, toxicity, and specific applications, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive information on the substance in question.

Formel:C9H12N2OS

InChl:InChI=1S/C9H12N2OS/c10-7-1-3-8(4-2-7)13(11,12)9-5-6-9/h1-4,9,11H,5-6,10H2

InChI Key:InChIKey=NLKQFDBGCBBXDX-UHFFFAOYSA-N

SMILES:O=S(=N)(C1=CC=C(N)C=C1)C2CC2

Sortieren nach


Mehr Kategorien anzeigen

Diese Suche enthält keine Kategorie.

3 Produktegefunden.

discount label

4-(Cyclopropylsulfonimidoyl)aniline

CAS:1523618-10-1

Ref: IN-DA0209DJ

1gNachfragen
5gNachfragen
100mg187,00 €
250mg309,00 €
Voraussichtliche Lieferung in Vereinigte Staaten, am Donnerstag 27. März 2025
discount label

4-(Cyclopropylsulfonimidoyl)aniline

CAS:1523618-10-1

Ref: 54-OR88176

1g1.456,00 €
100mg396,00 €
250mg632,00 €
500mg1.036,00 €
Voraussichtliche Lieferung in Vereinigte Staaten, am Freitag 28. März 2025
discount label

Ref: 10-F625339

1g968,00 €
5g3.568,00 €
100mg264,00 €
250mg407,00 €
500mg528,00 €
Voraussichtliche Lieferung in Vereinigte Staaten, am Dienstag 1. April 2025
Willkommen bei CymitQuimica!Wir verwenden Cookies, um Ihren Besuch zu verbessern. Wir schließen Werbung nicht ein.

Bitte beachten Sie unsere Cookie-Richtlinie  für weitere Details oder passen Sie Ihre Einstellungen unter “Konfigurieren” an.