
CAS 1895916-79-6
:9-[(1-Oxooctadecyl)oxy]octadecansäure
Beschreibung:
9-[(1-Oxooctadecyl)oxy]octadecansäure, auch bekannt unter seiner CAS-Nummer 1895916-79-6, ist ein Derivat von Fettsäuren, das durch eine lange Kohlenwasserstoffkette gekennzeichnet ist. Diese Verbindung weist eine Carbonsäure-Funktionalgruppe auf, die typisch für Fettsäuren ist, sowie eine Esterbindung, die eine Octadecanoyl-Gruppe mit einem 1-Oxoctadecyl-Moiety verbindet. Die Anwesenheit der Oxogruppe zeigt an, dass es eine Carbonylfunktionalität innerhalb der Kohlenwasserstoffkette gibt, die die Reaktivität und die physikalischen Eigenschaften der Verbindung beeinflussen kann. Diese Substanz wird wahrscheinlich amphiphile Eigenschaften aufweisen, was sie in polaren und unpolaren Lösungsmitteln löslich macht, was in verschiedenen Anwendungen wie Tensiden, Emulgatoren oder in der Formulierung von lipidhaltigen Arzneimittelsystemen nützlich ist. Ihr langer hydrophober Schwanz trägt zu ihrer potenziellen Verwendung in biologischen Systemen bei, während die polare Kopfgruppe mit wässrigen Umgebungen interagieren kann. Insgesamt ermöglicht die einzigartige Struktur dieser Verbindung vielfältige Anwendungen in der Chemie und Materialwissenschaft.
Formel:C36H70O4
InChl:InChI=1S/C36H70O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-25-29-33-36(39)40-34(30-26-22-19-10-8-6-4-2)31-27-23-21-24-28-32-35(37)38/h34H,3-33H2,1-2H3,(H,37,38)
InChI Key:InChIKey=NQJLCZWOOVLQNP-UHFFFAOYSA-N
SMILES:C(OC(CCCCCCCCCCCCCCCCC)=O)(CCCCCCCC(O)=O)CCCCCCCCC
Synonyme:- 9-[(1-Oxooctadecyl)oxy]octadecanoic acid
- Octadecanoic acid, 9-[(1-oxooctadecyl)oxy]-
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
2 Produkte.
9-Octadecanoyloxy-octadecanoic acid
CAS:9-Octadecanoyloxy-octadecanoic acid is a complex lipid, specifically a structured triglyceride. It is synthesized through esterification processes involving naturally sourced fatty acids such as stearic acid. This compound functions through its unique lipid structure, influencing cellular membrane interactions and potentially modulating lipid metabolism pathways. Its structural integrity allows for specific interactions within biological membranes, offering potential implications in altering membrane fluidity and permeability.Formel:C36H70O4Reinheit:Min. 95%Molekulargewicht:566.9 g/mol9-SAHSA
CAS:Branched fatty acid esters of hydroxy fatty acids (FAHFAs) are lipids that are modulated by dietary changes such as fasting and high-fat diets, and they play a role in insulin sensitivity. These compounds generally consist of a fatty acid chain of either 16 or 18 carbons (for example, palmitoleic, palmitic, oleic, or stearic acid) esterified to a similarly long hydroxy fatty acid. One specific FAHFA, 9-SAHSA, features stearic acid esterified at the 9th carbon of hydroxy stearic acid. The concentration of 9-SAHSA is notably increased in the serum of glucose-tolerant AG4OX mice, which specifically express the Glut4 glucose-transporting protein in adipose tissue.Formel:C36H70O4Farbe und Form:SolidMolekulargewicht:566.9

