CAS 20086-06-0
:Diosbulbin B
Beschreibung:
Diosbulbin B ist eine natürliche Verbindung, die als Sesquiterpenoid klassifiziert ist und hauptsächlich aus der Pflanze Dioscorea bulbifera, allgemein bekannt als Luftkartoffel, gewonnen wird. Diese Verbindung weist eine komplexe molekulare Struktur auf, die durch mehrere Ringe und funktionelle Gruppen gekennzeichnet ist, was zu ihrer biologischen Aktivität beiträgt. Diosbulbin B hat in der pharmakologischen Forschung Aufmerksamkeit erregt, aufgrund seiner potenziellen entzündungshemmenden, krebsbekämpfenden und antimikrobiellen Eigenschaften. Sein Wirkmechanismus könnte die Modulation verschiedener Signalwege umfassen, obwohl spezifische Details noch untersucht werden. Die Verbindung wird typischerweise im Kontext der traditionellen Medizin und moderner therapeutischer Anwendungen untersucht, was ihre Bedeutung sowohl in der Ethnopharmakologie als auch in der Arzneimittelentdeckung hervorhebt. Darüber hinaus können die Löslichkeit und Stabilität von Diosbulbin B je nach Lösungsmittel und Umweltbedingungen variieren, was wichtige Faktoren sind, die in experimentellen Einstellungen berücksichtigt werden müssen. Insgesamt stellt Diosbulbin B ein vielversprechendes Forschungsfeld innerhalb der Naturstoffchemie und der medizinischen Forschung dar.
Formel:C19H20O6
InChl:InChI=1S/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3
InChI Key:InChIKey=QEANLIISUSNNDX-UHFFFAOYSA-N
SMILES:CC12C3(CC(OC3=O)C4C1CC5CC4C(=O)O5)OC(C2)C=6C=COC6
Synonyme:- (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-2-(3-Furanyl)octahydro-11b-methyl-4H-3a,6:7,10-dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione
- 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-
- 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, [2R-(2α,3aβ,6β,6aβ,7β,10β,11aα,11bβ)]-
- Diosbulbin B
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
7 Produkte.
Diosbulbin B
CAS:Diosbulbin B has potential anti-tumor effects which may be related to influencing the immune system for the first time, it also exhibits potential hepatotoxicity.Formel:C19H20O6Reinheit:95%~99%Molekulargewicht:344.363Diosbulbin B
CAS:<p>Diosbulbin B is hepatotoxic and may have anti-tumor properties via immune system modulation.</p>Formel:C19H20O6Reinheit:98.92% - 99.84%Farbe und Form:SolidMolekulargewicht:344.36Diosbulbin B
CAS:<p>Diosbulbin B is a naturally occurring sesquiterpene lactone, which is derived primarily from the plant Dioscorea bulbifera, commonly known as "air potato" or "bitter yam." As a bioactive compound, Diosbulbin B demonstrates a mode of action that involves the induction of cytotoxicity in malignant cells, primarily through the disruption of microtubule dynamics, leading to cell cycle arrest and apoptosis.</p>Formel:C19H20O6Reinheit:Min. 98 Area-%Farbe und Form:PowderMolekulargewicht:344.36 g/mol





