CAS 264273-08-7
:(4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-2H-2-benzazepin-2-essigsäure
Beschreibung:
Die chemische Substanz, die als (4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-2H-2-benzazepin-2-essigsäure bekannt ist, mit der CAS-Nummer 264273-08-7, ist eine komplexe organische Verbindung, die durch ihre einzigartigen strukturellen Merkmale gekennzeichnet ist. Sie enthält einen Benzazepin-Kern, der eine bicyclische Struktur ist, die sowohl einen Benzolring als auch einen siebengliedrigen Stickstoffring umfasst. Das Vorhandensein einer Fluorenylmethoxycarbonylgruppe (Fmoc) deutet darauf hin, dass diese Verbindung wahrscheinlich in der Peptidsynthese als Schutzgruppe für Aminosäuren verwendet wird. Die tetrahydro Struktur deutet darauf hin, dass sie ein gesättigtes Ringsystem hat, was zu ihrer Stabilität und Reaktivität beiträgt. Darüber hinaus impliziert das Vorhandensein einer Carbonsäurefunktionalität das Potenzial für Wasserstoffbrückenbindungen und Wechselwirkungen mit anderen Molekülen, was sie in biochemischen Anwendungen relevant macht. Insgesamt positioniert die komplexe Struktur und die funktionellen Gruppen dieser Verbindung sie als eine bedeutende Entität in der medizinischen Chemie und der Arzneimittelentwicklung, insbesondere im Kontext der Peptid- und Proteinsynthese.
Formel:C27H24N2O5
InChl:InChI=1S/C27H24N2O5/c30-25(31)15-29-14-18-8-2-1-7-17(18)13-24(26(29)32)28-27(33)34-16-23-21-11-5-3-9-19(21)20-10-4-6-12-22(20)23/h1-12,23-24H,13-16H2,(H,28,33)(H,30,31)/t24-/m0/s1
InChI Key:InChIKey=RPAHAHMAXJASPS-DEOSSOPVSA-N
SMILES:C(OC(N[C@H]1CC=2C(CN(CC(O)=O)C1=O)=CC=CC2)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyme:- (4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-2H-2-benzazepine-2-acetic acid
- (S)-Fmoc-4-Amino-2-Carboxymethyl-1,3,4,5-Tetrahydro-2H-[2]-Benzazepin-3-One
- 2H-2-Benzazepine-2-acetic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-, (4S)-
- Fmoc-(S)-4-Amino-2-Carboxymethyl-1,3,4,5-Tetrahydro-2H-[2]-Benzazepin-3-One
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
2 Produkte.
(4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-2H-2-benzazepine-2-acetic acid
CAS:Formel:C27H24N2O5Farbe und Form:SolidMolekulargewicht:456.4899Fmoc-(S)-4-amino-2-carboxymethyl-1,3,4,5-tetrahydro-2H-[2]benzazepin-3-one
CAS:<p>Fmoc-(S)-4-amino-2-carboxymethyl-1,3,4,5-tetrahydro-2H-[2]benzazepin-3-one is a specialized chemical compound, which is an Fmoc-protected amino acid derivative. This compound is synthesized through a series of organic synthesis steps that incorporate chiral precursors to ensure enantiomeric purity. As a building block for peptide synthesis, it acts by introducing a protected amino function into the peptide chain, providing stability and selectivity during the synthesis process.The primary applications of Fmoc-(S)-4-amino-2-carboxymethyl-1,3,4,5-tetrahydro-2H-[2]benzazepin-3-one are in the fields of medicinal chemistry and drug discovery, where it plays a crucial role in the development of novel peptide-based therapeutics. This compound is particularly valuable due to its ability to enhance the bioavailability and metabolic stability of peptides, allowing for the exploration of new therapeutic pathways and functions. Its use is integral in the design of peptides with specific biological activities, facilitating research into new pharmacological agents and treatments.</p>Formel:C27H24N2O5Reinheit:Min. 95%Molekulargewicht:456.49 g/mol

