CAS 375-51-9
:2-Iodononafluorbutan
Beschreibung:
2-Iodononafluorbutan, mit der CAS-Nummer 375-51-9, ist eine halogenierte organische Verbindung, die durch das Vorhandensein von sowohl Iod- als auch Fluoratomen in ihrer molekularen Struktur gekennzeichnet ist. Diese Verbindung weist ein Butan-Rückgrat auf, das aus vier Kohlenstoffatomen besteht, und ist spezifisch an der zweiten Kohlenstoffposition mit einem Iodatom substituiert, während die verbleibenden Kohlenstoffatome vollständig fluoriert sind. Das Vorhandensein mehrerer Fluoratome verleiht einzigartige Eigenschaften, wie hohe thermische Stabilität und niedrige Oberflächenspannung, was sie in verschiedenen Anwendungen nützlich macht, einschließlich als Lösungsmittel oder in spezialisierten chemischen Synthesen. Darüber hinaus kann das Iodatom die Reaktivität erhöhen, was weitere chemische Transformationen ermöglicht. 2-Iodononafluorbutan ist typischerweise eine farblose Flüssigkeit bei Raumtemperatur und kann aufgrund der starken C-F-Bindungen eine geringe Flüchtigkeit aufweisen. Sicherheitsüberlegungen sind wichtig, wenn man mit dieser Verbindung umgeht, da sowohl Iod als auch fluorierte Verbindungen Gesundheitsrisiken darstellen können. Angemessene Lager- und Handhabungsprotokolle sollten befolgt werden, um potenzielle Gefahren im Zusammenhang mit ihrer Verwendung zu mindern.
Formel:C4F9I
InChl:InChI=1/C4F9I/c5-1(6,3(8,9)10)2(7,14)4(11,12)13
SMILES:C(C(C(F)(F)F)(F)I)(C(F)(F)F)(F)F
Synonyme:- 2-Iodoperfluorobutane~Perfluoroisobutyl iodide
- 1,1,1,2,2,3,4,4,4-Nonafluoro-3-Iodobutane
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
4 Produkte.
2-Iodononafluorobutane
CAS:2-Iodononafluorobutane
Reinheit:98%Farbe und Form:Pale Yellow LiquidMolekulargewicht:345.93g/mol2-Iodononafluorobutane
CAS:2-Iodononafluorobutane is a halogenated organic compound, which is commonly used in the field of organic chemistry as a specialized reagent. It is derived from nonafluorobutyl iodide, and it exhibits unique reactivity due to the presence of both iodine and fluorine atoms within its molecular structure. These halogens confer distinct characteristics, including enhanced electronegativity and bond polarity, making the compound highly effective for specific chemical transformations.The mode of action of 2-Iodononafluorobutane primarily involves its role as an electrophile, reacting with nucleophiles in various synthetic pathways. The highly electronegative fluorine atoms influence the compound's reactivity profile, often facilitating reactions such as nucleophilic substitutions and coupling processes. Its utility is further underscored by the ability to introduce fluorinated groups into organic molecules, a key step in the development of pharmaceuticals, agrochemicals, and advanced materials.Applications of 2-Iodononafluorobutane are extensive in synthetic organic chemistry, where it is employed to achieve selective carbon-iodine bond formation or functional group transformations. Its role as a building block in the synthesis of complex fluorinated compounds is invaluable for research and development across multiple scientific disciplines.Formel:C4F9IReinheit:Min. 95%Molekulargewicht:345.93 g/mol



