CAS 41429-52-1
:(1R,4aR,6S,8aR)-8a,9,9-trimethyl-4a,5,6,7,8,8a-hexahydro-1,6-methanonaphthalin-1(2H)-ol
Beschreibung:
Die chemische Substanz, die als "(1R,4aR,6S,8aR)-8a,9,9-trimethyl-4a,5,6,7,8,8a-hexahydro-1,6-methanonaphthalin-1(2H)-ol" bekannt ist, mit der CAS-Nummer 41429-52-1, ist eine bicyclische Verbindung, die durch ihre komplexe Stereochemie und spezifische funktionelle Gruppen gekennzeichnet ist. Diese Verbindung weist eine naftalinähnliche Struktur auf, die gesättigt ist, was darauf hinweist, dass sie mehrere Kohlenstoffatome in einem zyklischen Format angeordnet hat, wobei Wasserstoffatome die verbleibenden Valenzen ausfüllen. Das Vorhandensein von Hydroxylgruppen (-OH) deutet darauf hin, dass sie alkoholische Eigenschaften aufweist, die ihre Löslichkeit und Reaktivität beeinflussen können. Die stereochemischen Beschreibungen zeigen an, dass das Molekül mehrere chirale Zentren hat, was zu seinem Potenzial für Isomerie beiträgt und seine biologische Aktivität und Wechselwirkungen beeinflusst. Solche Verbindungen könnten in Bereichen wie der organischen Synthese, der medizinischen Chemie oder der Forschung zu Naturstoffen von Interesse sein, aufgrund ihrer einzigartigen strukturellen Merkmale und potenziellen Anwendungen. Insgesamt machen die Eigenschaften der Verbindung sie zu einem interessanten Thema für weitere Studien in verschiedenen chemischen und pharmazeutischen Kontexten.
Formel:C14H22O
InChl:InChI=1S/C14H22O/c1-12(2)10-6-8-13(3)11(9-10)5-4-7-14(12,13)15/h4-5,10-11,15H,6-9H2,1-3H3
InChI Key:InChIKey=OSQSDJNIURJARY-UHFFFAOYSA-N
SMILES:CC12C3(O)C(C)(C)C(CC1C=CC3)CC2
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
1 Produkte.
(+)-Norpatchoulenol
CAS:Kontrolliertes Produkt(+)-Norpatchoulenol is a sesquiterpene alcohol, which is a type of naturally occurring organic compound. It is primarily sourced from essential oils of various plants, particularly those in the Patchouli family. The compound is characterized by its three isoprene units that make up the foundational structure of sesquiterpenes, contributing to its aromatic properties.The mode of action of (+)-Norpatchoulenol primarily involves interactions with biological membranes and modulation of receptor activities, which can influence various biological pathways. Its specific interactions at the molecular level can result in effects such as anti-inflammatory and antimicrobial activities, although detailed mechanistic studies are still required to fully elucidate its pharmacodynamics.In terms of applications, (+)-Norpatchoulenol has garnered interest for its potential pharmacological properties. Its bioactivity suggests possible uses in therapeutic settings, particularly in the development of new anti-inflammatory or antimicrobial treatments. Additionally, its fragrance and stability make it a candidate for incorporation into cosmetics and personal care products, where both functional and aromatic qualities are desired. Research continues into its broader spectrum of biological effects and potential integration into novel pharmaceutical formulations.Formel:C14H22OReinheit:Min. 95%Molekulargewicht:206.32 g/mol
