
CAS 445493-23-2
:(4R,7R,8S,9E,11S,12S)-8-(Acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyloxacyclododec-9-en-2-on
Beschreibung:
Die chemische Substanz mit dem Namen "(4R,7R,8S,9E,11S,12S)-8-(Acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyloxacyclododec-9-en-2-on" und der CAS-Nummer "445493-23-2" ist eine komplexe organische Verbindung, die durch ihre komplizierte Stereochemie und mehrere funktionelle Gruppen gekennzeichnet ist. Sie weist eine bicyclische Struktur mit Hydroxyl- und Acetyloxy-Substituenten auf, was auf eine potenzielle biologische Aktivität hinweist, möglicherweise als Naturprodukt oder dessen Derivat. Das Vorhandensein mehrerer chiraler Zentren deutet darauf hin, dass sie stereospezifische Wechselwirkungen in biologischen Systemen aufweisen könnte. Darüber hinaus enthält die Verbindung einen Oxiranring, der für seine Reaktivität bekannt ist, insbesondere bei nucleophilen Additionsreaktionen. Ihre strukturelle Komplexität kann zu einzigartigen Eigenschaften wie Löslichkeit und Stabilität beitragen, die ihre potenziellen Anwendungen in der Pharmazeutik oder Agrochemie beeinflussen. Insgesamt veranschaulicht diese Verbindung die Vielfalt organischer Moleküle und deren potenzielle Rollen in verschiedenen chemischen und biologischen Prozessen.
Formel:C30H48O8
InChl:InChI=1S/C30H48O8/c1-8-24(33)21(5)29-25(37-29)16-18(2)10-9-11-19(3)28-20(4)12-13-26(36-22(6)31)30(7,35)15-14-23(32)17-27(34)38-28/h9-13,18,20-21,23-26,28-29,32-33,35H,8,14-17H2,1-7H3/b10-9+,13-12+,19-11+/t18-,20+,21-,23-,24+,25-,26+,28-,29-,30-/m1/s1
InChI Key:InChIKey=SDOUORKJIJYJNW-QHOUZYGJSA-N
SMILES:C([C@@H](/C=C/C=C(\C)/[C@@H]1[C@@H](C)/C=C/[C@H](OC(C)=O)[C@](C)(O)CC[C@@H](O)CC(=O)O1)C)[C@@H]2[C@@]([C@@H]([C@H](CC)O)C)(O2)[H]
Synonyme:- Oxacyclododec-9-en-2-one, 8-(acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyl-, (4R,7R,8S,9E,11S,12S)-
- 11107B
- Oxacyclododec-9-en-2-one, 8-(acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]oxiranyl]-1,5-dimethyl-1,3-hexadienyl]-7,11-dimethyl-, (4R,7R,8S,9E,11S,12S)-
- (4R,7R,8S,9E,11S,12S)-8-(Acetyloxy)-4,7-dihydroxy-12-[(1E,3E,5S)-6-[(2R,3R)-3-[(1R,2S)-2-hydroxy-1-methylbutyl]-2-oxiranyl]-1,5-dimethyl-1,3-hexadien-1-yl]-7,11-dimethyloxacyclododec-9-en-2-one
- Pladienolide B
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
3 Produkte.
Pladienolide B
CAS:Pladienolide B, a macrolide from Streptomyces, inhibits spliceosome's SF3B1, causing necrosis and antitumor effects for leukemia and lymphoid studies.Formel:C30H48O8Reinheit:98.27% - 98.27%Farbe und Form:SolidMolekulargewicht:536.7Pladienolide B
CAS:<p>Pladienolide B is a natural macrocyclic compound, which is a secondary metabolite derived from the culture broth of the bacterium Streptomyces platensis. It functions as a selective inhibitor of the spliceosome, a complex responsible for pre-mRNA splicing. By binding to the SF3b subunit of the spliceosome, Pladienolide B disrupts normal splicing processes, leading to alterations in gene expression. This disruption affects the growth and survival of cancer cells, demonstrating significant antitumor activity in various cancer models.Pladienolide B's unique mechanism of targeting the spliceosome makes it a subject of interest in cancer research, particularly for malignancies resistant to conventional therapies. Its efficacy in preclinical studies highlights its potential as a lead compound for the development of novel anticancer drugs. Researchers investigate its applications in targeting specific cancer types, exploring synergies with other treatments, and understanding resistance mechanisms, making it an important tool in both basic research and therapeutic exploration.</p>Formel:C30H48O8Molekulargewicht:536.7 g/mol


