CAS 54081-48-0
:Isoastilbin
Beschreibung:
Isoastilbin, mit der CAS-Nummer 54081-48-0, ist eine natürlich vorkommende Flavonoidverbindung, die hauptsächlich aus verschiedenen Pflanzenquellen gewonnen wird. Sie zeichnet sich durch ihre polyphenolische Struktur aus, die zu ihren antioxidativen Eigenschaften beiträgt. Isoastilbin zeigt eine Reihe biologischer Aktivitäten, einschließlich entzündungshemmender, antimikrobieller und potenzieller antikrebswirksamer Effekte, was sie für die pharmakologische Forschung von Interesse macht. Die Verbindung ist in organischen Lösungsmitteln löslich und hat eine begrenzte Löslichkeit in Wasser, was ihre Bioverfügbarkeit und Wirksamkeit in biologischen Systemen beeinflussen kann. Die chemische Struktur von Isoastilbin umfasst mehrere Hydroxylgruppen, die ihre Reaktivität und Wechselwirkung mit biologischen Makromolekülen erhöhen. Darüber hinaus kann ihre Stabilität durch Umweltfaktoren wie Licht und pH beeinflusst werden, was für ihre Anwendung in der Lebensmittel- und Pharmaindustrie entscheidend ist. Insgesamt stellt Isoastilbin ein bedeutendes Forschungsgebiet dar, das aufgrund seiner potenziellen gesundheitlichen Vorteile und Anwendungen in der Naturstoffchemie von Bedeutung ist.
Formel:C21H22O11
InChl:InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3/t7-,15-,17+,18+,19+,20+,21-/m0/s1
InChI Key:InChIKey=ZROGCCBNZBKLEL-OOHAXVOVSA-N
SMILES:O([C@H]1[C@H](OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4
Synonyme:- 4H-1-Benzopyran-4-one, 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-, (2R-cis)-
- 4H-1-Benzopyran-4-one, 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-, (2R,3S)-
- Isoastilbin
- (2R,3S)-Astilbin
- (2R,3S)-3-[(6-Deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
6 Produkte.
Isoastilbin
CAS:Isoastilbin is a dihydroflavonol glycoside compound in Rhizoma Smilacis glabrae and Astragalus membranaceus.Formel:C21H22O11Reinheit:99.54% - 99.95%Farbe und Form:SolidMolekulargewicht:450.39Ref: TM-TN1772
1mg105,00€2mg157,00€5mg260,00€1mL*10mM (DMSO)295,00€10mg385,00€25mg628,00€50mg872,00€100mg1.153,00€Isoastilbin
CAS:Isoastilbin is a bioactive flavonoid, which is a naturally occurring compound found primarily in certain plant species, such as the Chinese herb Smilax glabra and Engelhardtia roxburghiana Wall leaf. As a derivative of astilbin, it possesses a unique mechanism that involves the modulation of cellular redox states. Isoastilbin's mode of action is primarily through its antioxidant properties, where it scavenges free radicals and thus, mitigates oxidative stress at a cellular level. Additionally, it exhibits anti-inflammatory effects by inhibiting the production of pro-inflammatory cytokines.The applications of Isoastilbin are diverse and promising in scientific research. It is extensively studied for its potential therapeutic benefits in combating diseases associated with oxidative stress and inflammation, such as cardiovascular diseases, neurodegenerative disorders, and certain metabolic syndromes. Furthermore, its role in cell signaling and apoptosis makes it a candidate for cancer research, offering insights into the molecular pathways that can be targeted for therapeutic intervention. Isoastilbin’s multifunctional properties make it a compelling subject for ongoing pharmacological and biomedical research.Formel:C21H22O11Reinheit:Min. 95%Farbe und Form:PowderMolekulargewicht:450.39 g/mol





