CAS 76735-58-5
:Cannflavin B
Beschreibung:
Cannflavin B ist eine flavonoidhaltige Verbindung, die hauptsächlich in Cannabis-Pflanzen vorkommt, insbesondere in der Art Cannabis sativa. Sie gehört zu einer Klasse von Verbindungen, die als Flavone bekannt sind und sich durch ihre polyphenolische Struktur auszeichnen. Cannflavin B ist bemerkenswert für seine potenziellen entzündungshemmenden und schmerzlindernden Eigenschaften, die sowohl in medizinischen als auch in therapeutischen Kontexten Interesse geweckt haben. Man glaubt, dass diese Verbindung wirkt, indem sie die Produktion bestimmter entzündungsfördernder Mediatoren hemmt, was sie zu einem Forschungsgegenstand für ihre potenziellen Anwendungen im Schmerzmanagement und bei entzündungsbedingten Erkrankungen macht. Cannflavin B wird auch für seine Rolle in den Abwehrmechanismen der Pflanze gegen Schädlinge und Krankheitserreger anerkannt. Seine einzigartige chemische Struktur, die ein prenylierter Flavonoid-Rückgrat umfasst, trägt zu seiner biologischen Aktivität und potenziellen gesundheitlichen Vorteilen bei. Während die Forschung fortschreitet, könnte Cannflavin B Einblicke in neuartige therapeutische Mittel aus natürlichen Quellen bieten, insbesondere im Bereich der Cannabinoidforschung und Phytochemie.
Formel:C21H20O6
InChl:InChI=1S/C21H20O6/c1-11(2)4-6-13-15(23)9-19-20(21(13)25)16(24)10-17(27-19)12-5-7-14(22)18(8-12)26-3/h4-5,7-10,22-23,25H,6H2,1-3H3
InChI Key:InChIKey=IXCUTZUASDSIJO-UHFFFAOYSA-N
SMILES:OC1=C2C(OC(=CC2=O)C3=CC(OC)=C(O)C=C3)=CC(O)=C1CC=C(C)C
Synonyme:- Canniflavone 1
- 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-butenyl)-
- 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-buten-1-yl)-
- Cannflavin B
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
4 Produkte.
Cannflavin B
CAS:Cannflavin B, a prenylated flavone derived from Cannabis sativa L., exhibits anti-inflammatory activity [1].Formel:C21H20O6Farbe und Form:SolidMolekulargewicht:368.38Cannflavin B
CAS:Kontrolliertes ProduktApplications Cannflavin B is a prenylated flavone which can be isolated from the cannabinoid free ethanolic extract of Cannabis sativa L.
References Barrett, M. L., Experientia, 42, 452-3, (1986)Formel:C21H22O6Farbe und Form:NeatMolekulargewicht:370.3958Cannflavin B
CAS:Cannflavin B is a specialized flavonoid compound, which is a secondary metabolite derived from Cannabis sativa. It exhibits a distinct mode of action as a potent anti-inflammatory agent. Cannflavin B exerts its effects through the inhibition of pro-inflammatory mediators such as prostaglandins and leukotrienes. These biochemical pathways are typically linked with the cyclooxygenase (COX) and lipoxygenase (LOX) enzymes, and Cannflavin B effectively interferes with these enzymatic processes to reduce inflammation at the molecular level.
Formel:C21H20O6Reinheit:Min. 95 Area-%Farbe und Form:PowderMolekulargewicht:368.38 g/molRef: 3D-XC176307
Ausgelaufenes produkt



