CAS: 79438-97-4 - 3,5,12-trihydroxy-10-methoxy-6,11-dioxo-3-(2-oxopropyl)-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-amino-2,3,6-trideoxyhexopyranoside
Formel:C28H31NO10
InChl:InChI=1/C28H31NO10/c1-11(30)8-28(36)9-14-20(17(10-28)39-18-7-15(29)23(31)12(2)38-18)27(35)22-21(25(14)33)24(32)13-5-4-6-16(37-3)19(13)26(22)34/h4-6,12,15,17-18,23,31,33,35-36H,7-10,29H2,1-3H3
Marke | Produktdaten | Reinheit | Preisklasse | Voraussichtliche Lieferung |
---|---|---|---|---|
Daunorubicin Impurity C (Mixture of Diastereomers) REF: 4Z-D-484CAS: 79438-97-4 | - - - | - - - | Ausgelaufenes produkt | |
Feudomycin B REF: 3D-FF180028CAS: 79438-97-4 | Min. 95% | - - - | Ausgelaufenes produkt |
Daunorubicin Impurity C (Mixture of Diastereomers)
Ref: 4Z-D-484
10mg | Ausgelaufen | Anforderung von Informationen | |
25mg | Ausgelaufen | Anforderung von Informationen | |
50mg | Ausgelaufen | Anforderung von Informationen | |
100mg | Ausgelaufen | Anforderung von Informationen |
Feudomycin B
Ref: 3D-FF180028
Unbestimmte Größe | Ausgelaufen | Anforderung von Informationen |