CAS 81-88-9

Rhodamin B

Beschreibung:

Rhodamin B ist ein synthetischer Farbstoff, der zur Klasse der Xanthene gehört und durch seine lebendige rosa bis rötliche Farbe gekennzeichnet ist. Er wird häufig in verschiedenen Anwendungen eingesetzt, darunter Textilien, Papier und als fluoreszierender Tracer in biologischen und umweltwissenschaftlichen Studien. Die chemische Formel von Rhodamin B lautet C28H31ClN2O3S, und sein Molekulargewicht beträgt etwa 479,09 g/mol. Diese Verbindung weist starke Fluoreszenzeigenschaften auf, was sie nützlich in der Fluoreszenzmikroskopie und als Marker in biochemischen Tests macht. Rhodamin B ist in Wasser und organischen Lösungsmitteln wie Ethanol und Aceton löslich, aber seine Löslichkeit kann je nach pH variieren. Es ist wichtig zu beachten, dass Rhodamin B toxisch und potenziell krebserregend sein kann, was eine sorgfältige Handhabung und Entsorgung erforderlich macht. Darüber hinaus wurde es auf seine Fotostabilität und potenzielle Anwendungen in der photodynamischen Therapie untersucht. Insgesamt ist Rhodamin B eine vielseitige chemische Verbindung mit erheblichem Nutzen sowohl in industriellen als auch in Forschungsumgebungen.

Formel:C₂₈H₃₁N₂O₃·Cl

InChl:InChI=1S/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H,5-8H2,1-4H3;1H

InChI Key:InChIKey=PYWVYCXTNDRMGF-UHFFFAOYSA-N

SMILES:C(O)(=O)C1=C(C=2C3=C([O+]=C4C2C=CC(N(CC)CC)=C4)C=C(N(CC)CC)C=C3)C=CC=C1.[Cl-]

Synonyme:

11411 Red
3,6-Diamino-N,N'-Tetraaethylfluoran Chlorid
9-(2-Carboxyphenyl)-3,6-Bis(Diethylamine)- Xanthylium Chloride
9-(2-Carboxyphenyl)-3,6-Bis(Diethylamino)Xanthylium Chloride
9-(2-Carboxyphenyl)-3,6-bis(diethylamino)xanthyliumchlorid
ADC Rhodamine B
Aizen Rhodamine B
Aizen Rhodamine BH
Aizen Rhodamine BHC
Akiriku Rhodamine B
Amezin Rhodamine B Liquid
Ammonium, [9-(o-carboxyphenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]diethyl-, chloride
Basazol Red 71L
Basazol Red 71P
Basic Rose Extract
Basic Rose Red
Basic Violet 10
Basonyl Red 540
Basonyl Red 545
Basonyl Red 545FL
Brilliant Pink B
Calcozine Red BX
Calcozine Rhodamine BXP
Cerise Toner X 1127
Chlorure de 9-(2-carboxyphenyl)-3,6-bis(diethylamino)xanthylium
Chromatint Rhodamine B
Cloruro De 9-(2-Carboxifenil)-3,6-Bis(Dietilamino)Xantilio
D & C Red 19
D and C Red No. 19
D&C Red No. 19
Diabasic Rhodamine B
Edicol Supra Rose B
Edicol Supra Rose BS
Eriosin Rhodamine B
Ethanaminium, N-[9-(2-carboxyphenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethyl-, chloride
FD And C Red No. 19
Flexo Red 540
Grm 980
Hexacol Rhodamine B Extra
Ikada Rhodamine B
Japan Red 213
Japan Red No. 213
Lc 6100
Mitsui Rhodamine BX
Op 312
Red No. 213
Rheonine B
Rhodamine 610 chloride
Rhodamine B
Rhodamine B 500
Rhodamine B 500 hydrochloride
Rhodamine B Extra
Rhodamine B Extra M 310
Rhodamine B Extra S
Rhodamine B-EX
Rhodamine BA
Rhodamine BA Export
Rhodamine BDC
Rhodamine BN
Rhodamine BS
Rhodamine BX
Rhodamine BXL
Rhodamine BXP
Rhodamine FB
Rhodamine Lake Red B
Rhodamine O
Rhodamine S
Rhodamine S (Russian)
Rhodamine, tetraethyl-
Sicilian Cerise Toner A 7127
Sumiplast Pink B
Symulex Magenta F
Symulex Rhodamine B Toner F
Takaoka Rhodamine B
Tetraethylrhodamine
Xanthylium, 9-(2-Carboxyphenyl)-3,6-Bis(Diethlamino)-, Chloride
Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride (1:1)
[9-(o-Carboxyphenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]diethylammonium chloride
Weitere Synonyme anzeigen

CAS 81-88-9

Rhodamin B

Rhodamine B

Ref: 3D-FR41351