
CAS 874279-17-1
:Pyrido[2,3-b]pyrazine-3-carboxaldehyde
Beschreibung:
Pyrido[2,3-b]pyrazine-3-carboxaldehyde is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings, along with an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure contributes to its potential reactivity, particularly in condensation reactions due to the presence of the aldehyde group, which can participate in nucleophilic attacks. Pyrido[2,3-b]pyrazine-3-carboxaldehyde is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. The compound may also exhibit fluorescence properties, making it useful in certain analytical applications. As with many heterocycles, its properties can be influenced by substituents and the surrounding environment, which can affect its stability and reactivity. Safety data should be consulted before handling, as with any chemical substance.
Formel:C8H5N3O
InChl:InChI=1S/C8H5N3O/c12-5-6-4-10-7-2-1-3-9-8(7)11-6/h1-5H
InChI Key:InChIKey=AVOYWCNKRKUPFG-UHFFFAOYSA-N
SMILES:C(=O)C1=NC2=C(N=C1)C=CC=N2
Synonyme:- Pyrido[2,3-b]pyrazine-3-carboxaldehyde
Sortieren nach
Der Reinheitsfilter ist nicht sichtbar, weil die aktuellen Produkte keine zugeordneten Reinheitsdaten für die Filterung besitzen.
0 Produkte.