CAS 90332-28-8
:3,5,8-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-on
Beschreibung:
3,5,8-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-on, auch bekannt unter seiner CAS-Nummer 90332-28-8, ist eine Flavonoidverbindung, die durch ihre komplexe polyphenolische Struktur gekennzeichnet ist. Diese Substanz weist mehrere Hydroxylgruppen auf, die zu ihren potenziellen antioxidativen Eigenschaften beitragen. Die Anwesenheit der Benzopyran-Einheit zeigt an, dass sie zur Klasse der Flavonoide gehört, die für verschiedene biologische Aktivitäten bekannt ist, einschließlich entzündungshemmender, antimikrobieller und krebsbekämpfender Wirkungen. Die spezifische Anordnung der Hydroxylgruppen an den aromatischen Ringen erhöht ihre Reaktivität und Löslichkeit in polaren Lösungsmitteln. Darüber hinaus kann diese Verbindung signifikante Wechselwirkungen mit biologischen Makromolekülen aufweisen, die die zellulären Signalwege beeinflussen. Ihre strukturellen Eigenschaften deuten auf potenzielle Anwendungen in der Pharmazie und in Nutraceuticals hin, insbesondere in Formulierungen, die darauf abzielen, die Gesundheit zu fördern und Krankheiten im Zusammenhang mit oxidativem Stress zu verhindern. Weitere Studien sind jedoch erforderlich, um ihre biologischen Aktivitäten und ihr therapeutisches Potenzial vollständig zu erhellen.
Formel:C15H10O8
InChl:InChI=1S/C15H10O8/c16-6-1-2-7(17)15-10(6)12(21)13(22)14(23-15)5-3-8(18)11(20)9(19)4-5/h1-4,16-20,22H
InChI Key:InChIKey=JGTKWAPKKUUANC-UHFFFAOYSA-N
SMILES:OC1=C2C(C(=O)C(O)=C(O2)C3=CC(O)=C(O)C(O)=C3)=C(O)C=C1
Synonyme:- 3,5,8,3′,4′,5′-Hexahydroxyflavone
- 3,5,8-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3,5,8-trihydroxy-2-(3,4,5-trihydroxyphenyl)-
- Flavone, 3,3′,4′,5,5′,8-hexahydroxy-
Sortieren nach
Reinheit (%)
0
100
|
0
|
50
|
90
|
95
|
100
1 Produkte.
3,3',4',5,5',8-Hexahydroxyflavone
CAS:<p>3,3',4',5,5',8-Hexahydroxyflavone is a naturally occurring flavonoid, which is a type of polyphenolic compound. It is derived from various plant sources, including fruits, vegetables, and certain medicinal herbs. The compound is characterized by its chemical structure, which includes multiple hydroxyl groups, contributing to its biological activity.<br><br>The mode of action of 3,3',4',5,5',8-Hexahydroxyflavone involves its interaction with various cellular pathways and enzymes. Primarily, it is known for its antioxidant properties, where it scavenges free radicals and reactive oxygen species, thereby reducing oxidative stress. Additionally, it may exhibit anti-inflammatory effects by modulating signaling pathways involved in inflammation.<br><br>In terms of uses and applications, 3,3',4',5,5',8-Hexahydroxyflavone is primarily explored in scientific research focusing on its potential health benefits. Studies investigate its role in disease prevention, particularly conditions associated with oxidative stress and inflammation, such as cardiovascular diseases and neurodegenerative disorders. While it holds promise in these areas, further research is necessary to fully understand its mechanisms and therapeutic potential.</p>Formel:C15H10O8Reinheit:Min. 95%Molekulargewicht:318.24 g/mol
