CAS 90411-12-4

Neochamaejasmin B

Beschreibung:

Neochamaejasmin B ist eine chemische Verbindung, die als Flavonoid klassifiziert ist, speziell als eine Art von Chalcon. Es stammt aus natürlichen Quellen, wird häufig in verschiedenen Pflanzen gefunden und ist bekannt für seine potenziellen biologischen Aktivitäten. Die Verbindung zeigt antioxidative Eigenschaften, die zu ihrer Rolle beim Schutz der Zellen vor oxidativem Stress beitragen können. Darüber hinaus wurde Neochamaejasmin B wegen seiner entzündungshemmenden und antimikrobiellen Wirkungen untersucht, was es in der pharmakologischen Forschung von Interesse macht. Seine Struktur weist typischerweise ein charakteristisches Flavonoid-Gerüst auf, das für seine vielfältigen biologischen Aktivitäten verantwortlich ist. Die Löslichkeit und Stabilität der Verbindung können je nach Lösungsmittel und Umweltbedingungen variieren, was ihre Anwendungen sowohl in der Forschung als auch in potenziellen therapeutischen Kontexten beeinflusst. Wie bei vielen Naturstoffen sind weitere Studien erforderlich, um seine Wirkmechanismen und potenziellen gesundheitlichen Vorteile vollständig zu klären.

Formel: C₃₀H₂₂O₁₀

InChl: InChI=1/C30H22O10/c31-15-5-1-13(2-6-15)29-25(27(37)23-19(35)9-17(33)11-21(23)39-29)26-28(38)24-20(36)10-18(34)12-22(24)40-30(26)14-3-7-16(32)8-4-14/h1-12,25-26,29-36H/t25-,26-,29-,30+/s2

InChI Key: InChIKey=RNQBLQALVMHBKH-HPZZALBMNA-N

SMILES: O=C1[C@]([C@@H](OC=2C1=C(O)C=C(O)C2)C3=CC=C(O)C=C3)([C@]4([C@H](OC=5C(C4=O)=C(O)C=C(O)C5)C6=CC=C(O)C=C6)[H])[H]

Synonyme:

• rel-(+)-(2R,2′S,3R,3′R)-2,2′,3,3′-Tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)[3,3′-bi-4H-1-benzopyran]-4,4′-dione
• (+)-Neochamaejasmin B
• [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, [2α,3α(2′S*,3′R*)]-(+)-
• [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, (2R,2′S,3R,3′R)-rel-(+)-
• Neochamaejasmin B

Neochamaejasmin B

CAS: 90411-12-4

Formel: C₃₀H₂₂O₁₀

Reinheit: 98%

Molekulargewicht: 542.4897

Ref: IN-DA00H3AT

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B

Reinheit: ≥95%

Molekulargewicht: 542.49g/mol

Ref: 54-BUP01902

Neochamaejasmin B

CAS: 90411-12-4

Formel: C₃₀H₂₂O₁₀

Reinheit: 95%~99%

Farbe und Form: Powder

Molekulargewicht: 542.496

Ref: BP-SBP03132

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B displays nematicidal activity against both Bursaphelenchus xylophilus and Bursaphelenchus mucronatus.

Formel: C₃₀H₂₂O₁₀

Reinheit: 97.89%

Farbe und Form: Solid

Molekulargewicht: 542.49

Ref: TM-TN1977

Neochamaejasmine B

CAS: 90411-12-4

Neochamaejasmine B is a natural bioactive compound, which is derived from the roots of Stellera chamaejasme L., a plant found in various regions of Asia. This compound is classified as a flavonoid, known for its diverse range of biological activities. Its mode of action involves interacting with cellular pathways that regulate processes such as inflammation, cell proliferation, and apoptosis. This multifaceted activity makes Neochamaejasmine B an attractive candidate for research into potential therapeutic applications. Studies have highlighted its potential in the treatment of conditions such as cancer, due to its ability to inhibit specific cancer cell lines, as well as its anti-inflammatory properties which could be beneficial in chronic inflammatory diseases. As research advances, further elucidation of its molecular mechanisms and therapeutic efficacy is anticipated, contributing valuable insights into its application in medicinal chemistry and pharmacology.

Formel: C₃₀H₂₂O₁₀

Reinheit: Min. 95%

Molekulargewicht: 542.5 g/mol

Ref: 3D-QDA41112