CAS: 921-08-4 - 2-chloro-3-methylbutanoic acid
Formel:C5H9ClO2
InChl:InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)
- Synonyme:
- Butanoic Acid, 2-Chloro-3-Methyl-
- 2-Chloro-3-methylbutanoic acid
| Marke | Produktdaten | Reinheit | Preisklasse | Voraussichtliche Lieferung |
|---|---|---|---|---|
 | Gliquidone Impurity 5 REF: 4Z-G-050007CAS: 921-08-4 | - - - | Nachfragen | Di 17 Dez 24 |
 | 2-chloro-3-methylbutanoic acid REF: IN-DA019VT8CAS: 921-08-4 | 97% | - - - | Ausgelaufenes produkt |
 | 2-Chloro-3-methylbutanoic acid REF: 10-F738161CAS: 921-08-4 | 97% | - - - | Ausgelaufenes produkt |
 | 2-Chloro-3-methylbutanoic acid REF: 3D-AAA92108CAS: 921-08-4 | Min. 95% | - - - | Ausgelaufenes produkt |
Ref: 4Z-G-050007
| 10mg | Nachfragen | ||
| 25mg | Nachfragen | ||
| 50mg | Nachfragen | ||
| 100mg | Nachfragen |
Voraussichtliche Lieferung in Vereinigte Staaten, am Dienstag 17. Dezember 2024
Ref: IN-DA019VT8
| 1g | Ausgelaufen | Anforderung von Informationen | |
| 5g | Ausgelaufen | Anforderung von Informationen | |
| 10g | Ausgelaufen | Anforderung von Informationen | |
| 2.5g | Ausgelaufen | Anforderung von Informationen | |
| 50mg | Ausgelaufen | Anforderung von Informationen | |
| 100mg | Ausgelaufen | Anforderung von Informationen | |
| 250mg | Ausgelaufen | Anforderung von Informationen | |
| 500mg | Ausgelaufen | Anforderung von Informationen |
Ref: 10-F738161
| 100mg | Ausgelaufen | Anforderung von Informationen |
2-Chloro-3-methylbutanoic acid
CAS:921-08-4
Please enquire for more information about 2-Chloro-3-methylbutanoic acid including the price, delivery time and more …
Formel:
C5H9ClO2
Reinheit:
Min. 95%
Molekulargewicht:
136.58 g/mol
Ref: 3D-AAA92108
| 1g | Ausgelaufen | Anforderung von Informationen | |
| 5g | Ausgelaufen | Anforderung von Informationen | |
| 10g | Ausgelaufen | Anforderung von Informationen | |
| 25g | Ausgelaufen | Anforderung von Informationen | |
| 50g | Ausgelaufen | Anforderung von Informationen | |
| 250mg | Ausgelaufen | Anforderung von Informationen | |
| 2500mg | Ausgelaufen | Anforderung von Informationen |
