CAS 92169-28-3
:12-methoxydodecanoic acid sodium
Formel:C13H26O3
InChl:InChI=1/C13H26O3/c1-16-12-10-8-6-4-2-3-5-7-9-11-13(14)15/h2-12H2,1H3,(H,14,15)
SMILES:COCCCCCCCCCCCC(=O)O
Synonyme:- 12-Methoxydodecanoate
- Nsc 666070
- Dodecanoic acid, 12-methoxy-
- 12-Methoxydodecanoic Acid
Sortieren nach
Der Reinheitsfilter ist nicht sichtbar, weil die aktuellen Produkte keine zugeordneten Reinheitsdaten für die Filterung besitzen.
1 Produkte.
12-Methoxydodecanoic acid
CAS:12-Methoxydodecanoic acid, a heteroatom-containing analog of myristic acid, exhibits anti-HIV activity with an IC50 of 6.8 μM. Additionally, it inhibits the Moloney murine leukemia virus (MoMLV).Formel:C13H26O3Farbe und Form:SolidMolekulargewicht:230.34
