Produktinformation
Name:2-Amino-5-methylpyridine
Marke:Biosynth
Beschreibung:2-Amino-5-methylpyridine is a chemical compound that belongs to the group of methyl ketones. It has a nitrogen atom and an oxygen atom in its structure, which allows it to form hydrogen bonds with other molecules. 2-Amino-5-methylpyridine can be obtained by reacting hydrochloric acid and xanthone in the presence of a base. The compound is highly reactive and has been shown to have antiinflammatory properties. This can be attributed to its ability to inhibit prostaglandin synthesis. 2-Amino-5-methylpyridine also has fluorescence properties that are sensitive to pH changes and can be used as a probe for metal ions.
2-Amino-5-methylpyridine is an organic compound that contains a methyl group, two nitrogen atoms, and one oxygen atom in its chemical structure. This molecule can form hydrogen bonds with other molecules due to its nitrogen atoms and oxygen atom,
2-Amino-5-methylpyridine is an organic compound that contains a methyl group, two nitrogen atoms, and one oxygen atom in its chemical structure. This molecule can form hydrogen bonds with other molecules due to its nitrogen atoms and oxygen atom,
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:108.14 g/mol
Formel:C6H8N2
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C6H8N2/c1-5-2-3-6(7)8-4-5/h2-4H,1H3,(H2,7,8)
InChI Key:InChIKey=CMBSSVKZOPZBKW-UHFFFAOYSA-N
SMILES:Cc1ccc(N)nc1
Technische Anfrage zu: 2-Amino-5-methylpyridine
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
