Produktinformation
Name:2-Amino-6-bromo-3-formylchromone
Marke:Biosynth
Beschreibung:2-Amino-6-bromo-3-formylchromone is a chemical compound with the molecular formula CHNO. It has a vibrational frequency of 1426.81 cm−1 and a potential energy of −29.35 kcal/mol. The molecule can be classified as an aromatic compound, due to the presence of one or more benzene rings in its structure, and is colored red or orange in solution. 2-Amino-6-bromo-3-formylchromone can be used to produce other compounds that have different spectral properties than it does, such as 2-(2-(2-(2-(2-(2-(benzoyloxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)-4'-nitroacetophenone.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:268.06 g/mol
Formel:C10H6BrNO3
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C10H6BrNO3/c11-5-1-2-8-6(3-5)9(14)7(4-13)10(12)15-8/h1-4H,12H2
InChI Key:InChIKey=AUIUQJYBTPKQGS-UHFFFAOYSA-N
SMILES:Nc1oc2ccc(Br)cc2c(=O)c1C=O
Technische Anfrage zu: 2-Amino-6-bromo-3-formylchromone
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.