Produktinformation
Name:1-Benzhydrylazetidin-3-one
Synonyme:
- 1-(Diphenylmethyl)-3-azetidinone
Marke:Biosynth
Beschreibung:The 1-benzhydrylazetidin-3-one molecule has an ionizing potential of 29.6 eV, which is the amount of energy required to remove one electron from the outermost shell of a hydrogen atom. The molecule is photoelectron reactive, with a reaction yield of 0.5%. It reacts with ultraviolet radiation and interacts with other molecules such as azetidine (2-methylaziridine). The 1-benzhydrylazetidin-3-one molecule has an ionization potential of 29.6 eV, which is the amount of energy required to remove one electron from the outermost shell of a hydrogen atom. The molecule is photoelectron reactive, with a reaction yield of 0.5%. It reacts with ultraviolet radiation and interacts with other molecules such as azetidine (2-methylaziridine).
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:237.3 g/mol
Formel:C16H15NO
Reinheit:Min. 95%
Farbe/Form:White To Beige Solid
InChl:InChI=1S/C16H15NO/c18-15-11-17(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16H,11-12H2
InChI Key:InChIKey=AVUDXLOVIBJFQA-UHFFFAOYSA-N
SMILES:O=C1CN(C(c2ccccc2)c2ccccc2)C1
Technische Anfrage zu: 1-Benzhydrylazetidin-3-one
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
