Produktinformation
Name:8-Bromotheophylline
Kontrolliertes Produkt
Marke:Biosynth
Beschreibung:
8-Bromotheophylline is a drug that binds to adenosine receptors and prevents the reuptake of adenosine, which leads to an increase in the concentration of adenosine at the receptor. It has been shown to inhibit the enzyme phosphodiesterase and potassium ion channels, leading to increased concentrations of serotonin in the brain. 8-Bromotheophylline is used for treating psychotic disorders such as schizophrenia and depression. 8-Bromotheophylline also has been shown to be effective against infectious diseases, including tuberculosis and infections caused by bacteria that are resistant to penicillin and erythromycin.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:259.06 g/mol
Formel:C7H7BrN4O2
Reinheit:Min. 95%
InChl:InChI=1S/C7H7BrN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10)
InChI Key:InChIKey=SKTFQHRVFFOHTQ-UHFFFAOYSA-N
SMILES:Cn1c(=O)c2[nH]c(Br)nc2n(C)c1=O
Technische Anfrage zu: 8-Bromotheophylline
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, fügen Sie bitte die gewünschten Produkte Ihrem Warenkorb hinzu und verwalten Sie die Anfrage von dort aus. Das ist schneller und günstiger, und Sie können von den verfügbaren Rabatten und weiteren Vorteilen profitieren.
