

Produktinformation
Name:1-(4-Bromophenyl)pyrrolidine
Marke:Biosynth
Beschreibung:1-(4-Bromophenyl)pyrrolidine is a heterocyclic organic compound that belongs to the group of aromatic compounds. It has a benzene ring and four morpholine rings. The molecular weight is 186.14 g/mol. 1-(4-Bromophenyl)pyrrolidine has an aromatic ring and two pyrrolidine rings, which is why it can be classified as a heterocycle. This chemical has a dipole, which means that one end of the molecule has a higher electron density than the other end. Substituents are atoms or groups of atoms that replace hydrogen atoms on the benzene ring in order to modify its properties. In 1-(4-Bromophenyl)pyrrolidine, substituents include bromine, hydrogen, and nitrogen atoms.
1-(4-Bromophenyl)pyrrolidine is an analogous compound because it shares similar properties with another chemical in its group
1-(4-Bromophenyl)pyrrolidine is an analogous compound because it shares similar properties with another chemical in its group
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:226.11 g/mol
Formel:C10H12BrN
Reinheit:Min. 95%
InChl:InChI=1S/C10H12BrN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h3-6H,1-2,7-8H2
InChI Key:InChIKey=BVEGBJXZICCEQW-UHFFFAOYSA-N
SMILES:Brc1ccc(N2CCCC2)cc1