Produktinformation
Name:3-(2-Bromoacetyl)-2H-chromen-2-one
Synonyme:
- 3-(ω-Bromoacetyl)coumarin
Marke:Biosynth
Beschreibung:3-(2-Bromoacetyl)-2H-chromen-2-one is a compound that has been shown to inhibit the growth of human liver cancer cells and has been used in the treatment of some cancers. 3-(2-Bromoacetyl)-2H-chromen-2-one is a nucleophile, which reacts with electrophiles, such as 2Nal, to form an intermediate covalent bond. The reaction mechanism for this process involves a nucleophilic substitution reaction, where one atom (the nucleophile) attacks another atom (the electrophile) from the side opposite its electron cloud. This process results in the formation of a covalent bond between the two atoms and the release of water. 3-(2-Bromoacetyl)-2H-chromen-2one was found to be effective against Streptococcus faecalis and other bacteria after being tested in vitro with these organisms. In addition to being
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:267.08 g/mol
Formel:C11H7BrO3
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C11H7BrO3/c12-6-9(13)8-5-7-3-1-2-4-10(7)15-11(8)14/h1-5H,6H2
InChI Key:InChIKey=NTYOLVNSXVYRTJ-UHFFFAOYSA-N
SMILES:O=C(CBr)c1cc2ccccc2oc1=O
Technische Anfrage zu: 3-(2-Bromoacetyl)-2H-chromen-2-one
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
