Produktinformation
Name:5-Bromo-2-methoxytoluene
Synonyme:
- 4-Bromo-1-methoxy-2-methylbenzene
Marke:Biosynth
Beschreibung:5-Bromo-2-methoxytoluene is a bromoarene that reacts to form aziridines and phosphotungstic acid. It is used in the synthesis of polyaromatic compounds with steric interactions. 5-Bromo-2-methoxytoluene is also a functional group that can be used as an allosteric modulator. This compound also has stereoisomers that are chiral, meaning they have different structures despite being mirror images of each other. The carbonyl group on the 5-bromo compound is polar, which means it has a charge. The hydrogen bonds between this compound and other molecules are nonpolar, which means they do not have a charge and are more likely to form in a nonpolar solvent.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:201.06 g/mol
Formel:C8H9BrO
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3
InChI Key:InChIKey=UDLRGQOHGYWLCS-UHFFFAOYSA-N
SMILES:COc1ccc(Br)cc1C
Technische Anfrage zu: 5-Bromo-2-methoxytoluene
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.