

Produktinformation
Name:4-Bromo-3-chlorophenol
Marke:Biosynth
Beschreibung:4-Bromo-3-chlorophenol is a chemical compound that has been shown to have cytotoxic effects on human cancer cells in vitro. This compound interacts with the nucleophilic sites of DNA and RNA and cleaves the phosphate ester bond, which leads to the formation of bromonium ions. These ions are then able to react with hydrogen atoms from water molecules, leading to deformation of the molecule. The compound also forms hydrogen bonds with other molecules, such as proteins, that can lead to cell death by interfering with their function. 4-Bromo-3-chlorophenol is a synthetic chemical that has not been tested for its toxicity in humans.
4-Bromo-3-chlorophenol is an irreversible oxidation process that takes place at room temperature and can be used to form bromonium ions. These ions are able to interact with hydrogen atoms from water molecules, leading to deformation of the molecule. The compound also
4-Bromo-3-chlorophenol is an irreversible oxidation process that takes place at room temperature and can be used to form bromonium ions. These ions are able to interact with hydrogen atoms from water molecules, leading to deformation of the molecule. The compound also
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:207.45 g/mol
Formel:C6H4BrClO
Reinheit:Min. 95%
InChl:InChI=1S/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H
InChI Key:InChIKey=FQEYHIPPYOSPLF-UHFFFAOYSA-N
SMILES:Oc1ccc(Br)c(Cl)c1