Produktinformation
Name:5-Chloro-2-pentanone
Marke:Biosynth
Beschreibung:5-Chloro-2-pentanone is a reactive, unsaturated ketone. It is a colorless liquid with a pungent odor. 5-Chloro-2-pentanone can be used in the synthesis of other organic compounds, such as covid-19 pandemic. The reaction of carbonyl groups with hydrogen chloride and chlorine atom to form hydrochloric acid and chlorocarbons is an example of a reaction that 5-chloro-2-pentanone can take part in. When 5-chloro-2-pentanone reacts with hydrogen chloride (HCl) and chlorine atom (Cl), the reaction products are hydrochloric acid (HCl) and chlorocarbons. This process is called nucleophilic attack and proceeds as follows: 5CH=C(CH)COH + HCl + Cl → CH=C(CH)COCl + H+ + Cl 5CH=C
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:120.58 g/mol
Formel:C5H9ClO
Reinheit:Min. 95%
Farbe/Form:Clear Liquid
InChl:InChI=1S/C5H9ClO/c1-5(7)3-2-4-6/h2-4H2,1H3
InChI Key:InChIKey=XVRIEWDDMODMGA-UHFFFAOYSA-N
SMILES:CC(=O)CCCCl
Technische Anfrage zu: 5-Chloro-2-pentanone
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
