Produktinformation
Name:Calix[4]arene
Synonyme:
- Tetrahydroxycalix[4]areneCalix[4]arene-25,26,27,28-tetrol
Marke:Biosynth
Beschreibung:Calix[4]arenes are a group of aromatic compounds that can be used as optical sensors. They are characterized by the presence of four phenyl rings and an open cavity that is accessible to solvent molecules. The calix[4]arene molecule has two free electron pairs, which makes it possible for the molecule to form stable complexes with various test samples, such as hydrochloric acid, ammonia, and nitric acid. Calix[4]arenes also have linear calibration curves that can be used to measure concentrations of test samples. When heated in the presence of oxygen and water, calix[4]arenes will emit light at a wavelength between 500-600 nm. This light emission is due to an intramolecular hydrogen bond that is formed from the nitrogen atom on one ring to the oxygen atom on another ring.
Calix[4]arenes are also capable of transferring electrons from one ring to another through steric interactions. This process leads to light
Calix[4]arenes are also capable of transferring electrons from one ring to another through steric interactions. This process leads to light
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:424.49 g/mol
Formel:C28H24O4
Reinheit:Min. 98 Area-%
Farbe/Form:White Powder
InChl:InChI=1S/C28H24O4/c29-25-17-5-1-6-18(25)14-20-8-3-10-22(27(20)31)16-24-12-4-11-23(28(24)32)15-21-9-2-7-19(13-17)26(21)30/h1-12,29-32H,13-16H2
InChI Key:InChIKey=YPNHVQZZPXPQOS-UHFFFAOYSA-N
SMILES:Oc1c2cccc1Cc1cccc(c1O)Cc1cccc(c1O)Cc1cccc(c1O)C2
Technische Anfrage zu: Calix[4]arene
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
