Produktinformation
Name:3-Carboxypropanesulfonamide
Synonyme:
- 4-Sulfamoylbutyric acid
Marke:Biosynth
Beschreibung:3-Carboxypropanesulfonamide is a chemical compound that has been shown to have the ability to modulate cardiac cell function. This compound has been shown to be effective in a reaction monitoring technique, which monitors the functional groups and techniques of chemical reactions, in order to introduce this molecule into the cell membrane and alter its potential. 3-Carboxypropanesulfonamide is capable of changing the lipid composition of the membrane by introducing a linker group that can bind with other molecules such as cholesterol or phospholipids. This linker group alters the membrane potential of cells, leading to changes in ion flow and cellular response.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:167.18 g/mol
Formel:C4H9NO4S
Reinheit:Min. 95%
Farbe/Form:White Powder
InChl:InChI=1S/C4H9NO4S/c5-10(8,9)3-1-2-4(6)7/h1-3H2,(H,6,7)(H2,5,8,9)
InChI Key:InChIKey=OMPGKWICGUBROA-UHFFFAOYSA-N
SMILES:NS(=O)(=O)CCCC(=O)O
Technische Anfrage zu: 3-Carboxypropanesulfonamide
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
