

Produktinformation
Name:(S)-(-)-2-Chloropropionic acid
Synonyme:
- L-(a)-Chloropropionic acid(2S)-2-Chloropropanoic acid
Marke:Biosynth
Beschreibung:(S)-(-)-2-Chloropropionic acid is a biologically active molecule that can be used for the treatment of various diseases. It inhibits the production of voltage-dependent calcium channels, which are involved in the release of neurotransmitters and in locomotor activity. The inhibition of these channels leads to an increase in intracellular calcium levels and necrotic cell death. (S)-(-)-2-Chloropropionic acid has been shown to inhibit glutamate receptors, which are involved in the transmission of pain signals to the brain. This drug also binds to acid complexes, inhibiting their effects on cells and potentially leading to cancer cell death.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:108.52 g/mol
Formel:C3H5ClO2
Reinheit:Min. 95%
Farbe/Form:Colourless To Pale Yellow Liquid