Produktinformation
Name:4-Chlorobenzamide
Marke:Biosynth
Beschreibung:4-Chlorobenzamide is a quaternary ammonium compound that is used in the synthesis of other organic compounds. 4-Chlorobenzamide reacts with malonic acid to form a compound called 4-chlorobenzoic acid. The reaction mechanism involves formation of hydrogen bonds and an electrophilic substitution. 4-Chlorobenzamide is also found in environmental pollution, where it can be degraded by hydroxyl radicals and chlorine. It can be found as a chloride salt or amide depending on the pH. The functional groups are carbonyl group, which has a carbon atom double bonded to an oxygen atom, and hydroxyl group, which has a hydroxyl radical attached to a carbon atom.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:155.58 g/mol
Formel:C7H6ClNO
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C7H6ClNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)
InChI Key:InChIKey=BLNVISNJTIRAHF-UHFFFAOYSA-N
SMILES:NC(=O)c1ccc(Cl)cc1
Technische Anfrage zu: 4-Chlorobenzamide
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.