

Produktinformation
Name:Cyfluthrin
Marke:Biosynth
Beschreibung:Cyfluthrin is a pyrethroid insecticide that inhibits the activity of various enzymes, including those involved in the synthesis of proteins and nucleic acids. Cyfluthrin has been shown to synergize with other insecticides, such as carbamate or organophosphate compounds. It also has a sublethal effect on insects at low doses. Cyfluthrin is not genotoxic, but can cause biochemical and metabolic disorders in vertebrates. The toxicity of cyfluthrin can be determined by measuring its fluorescence spectrum using fluorescence spectrometry. The absorption spectrum and fluorescence emission spectra are then used to determine the chemical structure of cyfluthrin. Sodium citrate is used as an analytical reagent for cyfluthrin because it has been shown to increase the solubility of this compound in water.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:434.29 g/mol
Formel:C22H18Cl2FNO3
Reinheit:Min. 95%
SMILES:CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c1ccc(F)c(Oc2ccccc2)c1