Produktinformation
Name:2-Carbomethoxybenzaldehyde
Synonyme:
- Methyl 2-formylbenzoate2-Carbomethoxybenzaldehyde
Marke:Biosynth
Beschreibung:2-Carbomethoxybenzaldehyde (2CMB) is a synthetic chemical compound that has been used as an efficient method for the synthesis of amines. The carbonyl group in 2CMB reacts with nucleophiles, such as amines, to form a tetrahydroisoquinoline derivative. This nucleophilic attack leads to the formation of an unstable intermediate that can be isolated and purified by trifluoroacetic acid (TFA). 2CMB is also used in the synthesis of quinoline derivatives and naphthalene derivatives. The acidic properties of 2CMB allow it to react with carboxylic acids, leading to the formation of esters.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:164.16 g/mol
Formel:C9H8O3
Reinheit:Min. 95%
Farbe/Form:Colorless Powder
InChl:InChI=1S/C9H8O3/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-6H,1H3
InChI Key:InChIKey=YRMODRRGEUGHTF-UHFFFAOYSA-N
SMILES:COC(=O)c1ccccc1C=O
Technische Anfrage zu: 2-Carbomethoxybenzaldehyde
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.