Produktinformation
Name:1,3-Dibromoadamantane
Marke:Biosynth
Beschreibung:1,3-Dibromoadamantane is an organic compound that belongs to the group of organobromides. It has a chemical structure with three bromine atoms and one carbon atom, which are bonded to each other in a triangle shape. 1,3-Dibromoadamantane is soluble in solvents such as water and methanol. The reaction yield of 1,3-dibromoadamantane is 100% when it reacts with hydrochloric acid as the catalyst under optimal conditions. The reaction also occurs at a high temperature (100 degrees Celsius) and releases energy efficiently. 1,3-Dibromoadamantane can be used as a substrate molecule for the Suzuki coupling reaction.The coordination chemistry of 1,3-dibromoadamantane involves the formation of a square planar complex with copper ions and ammonia molecules to form copper(I) ammine complexes, which are then able to bind
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:294.03 g/mol
Formel:C10H14Br2
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C10H14Br2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8H,1-6H2
InChI Key:InChIKey=HLWZKLMEOVIWRK-UHFFFAOYSA-N
SMILES:BrC12CC3CC(C1)CC(Br)(C3)C2
Technische Anfrage zu: 1,3-Dibromoadamantane
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
