

Produktinformation
Name:Dimethyl 2-cyanosuccinate
Marke:Biosynth
Beschreibung:Dimethyl 2-cyanosuccinate is an organic compound that contains a protonated cycloalkyl ring, a pyrazole ring, and a pyridinium ion. It is activated with dibenzylamide to form the corresponding dibenzylamide salt. Dimethyl 2-cyanosuccinate has been shown to be effective against parasites such as Toxoplasma gondii and Trichinella spiralis. The mechanism of action of this drug is believed to be due to its ability to act as a nucleophile and react with anions. This reaction results in ring opening, which leads to the formation of reactive intermediates that cause cell death by either DNA cross-linking or irreversible protein modification.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:171.15 g/mol
Formel:C7H9NO4
Reinheit:Min. 95%
SMILES:COC(=O)CC(C#N)C(=O)OC