Produktinformation
Name:3,5-Dihydroxybenzamide
Marke:Biosynth
Beschreibung:3,5-Dihydroxybenzamide is an amide derivative that has anticancer activity. This compound inhibits the growth of C. glabrata by inhibiting protein synthesis in the mitochondria and DNA replication in the nucleus. 3,5-Dihydroxybenzamide also inhibits the growth of cancer cells by binding to a molecule that is involved in cancer cell proliferation. The inhibitor molecule binds to a specific site on the molecule, preventing it from forming new cancer cells. The mechanism of action for this compound is not known, but may be due to its ability to bind with chloride ions or its ability to form supramolecular chemistry with other molecules.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:153.14 g/mol
Formel:C7H7NO3
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C7H7NO3/c8-7(11)4-1-5(9)3-6(10)2-4/h1-3,9-10H,(H2,8,11)
InChI Key:InChIKey=PLYYMFBDRBSPJZ-UHFFFAOYSA-N
SMILES:NC(=O)c1cc(O)cc(O)c1
Technische Anfrage zu: 3,5-Dihydroxybenzamide
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
