Produktinformation
Name:2',4'-Dihydroxy-3',6'-Dimethoxychalcone
Marke:Biosynth
Beschreibung:2',4'-Dihydroxy-3',6'-Dimethoxychalcone is a chalcone derivative, which is a type of flavonoid compound. It is synthesized through organic chemistry methodologies, often derived from plant sources where chalcones naturally occur in various species. The mode of action for this compound involves the modulation of biological pathways, primarily through interactions with enzymes and receptors. These interactions can lead to effects such as antioxidation, anti-inflammatory, and potential antitumor activities.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:300.31 g/mol
Formel:C17H16O5
Reinheit:Min. 95 Area-%
InChl:InChI=1S/C17H16O5/c1-21-14-10-13(19)17(22-2)16(20)15(14)12(18)9-8-11-6-4-3-5-7-11/h3-10,19-20H,1-2H3/b9-8+
InChI Key:InChIKey=BXMWIRIMYNWIGQ-CMDGGOBGSA-N
SMILES:COc1cc(O)c(OC)c(O)c1C(=O)/C=C/c1ccccc1
Technische Anfrage zu: 2',4'-Dihydroxy-3',6'-Dimethoxychalcone
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.